EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H8O3 |
| Net Charge | 0 |
| Average Mass | 128.127 |
| Monoisotopic Mass | 128.04734 |
| SMILES | CC1=C(O)C(=O)C(C)O1 |
| InChI | InChI=1S/C6H8O3/c1-3-5(7)6(8)4(2)9-3/h3,8H,1-2H3 |
| InChIKey | INAXVXBDKKUCGI-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | flavouring agent A food additive that is used to added improve the taste or odour of a food. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Applications: | flavouring agent A food additive that is used to added improve the taste or odour of a food. fragrance A substance, extract, or preparation for diffusing or imparting an agreeable or attractive smell. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-hydroxy-2,5-dimethylfuran-3-one (CHEBI:76247) has role flavouring agent (CHEBI:35617) |
| 4-hydroxy-2,5-dimethylfuran-3-one (CHEBI:76247) has role fragrance (CHEBI:48318) |
| 4-hydroxy-2,5-dimethylfuran-3-one (CHEBI:76247) has role plant metabolite (CHEBI:76924) |
| 4-hydroxy-2,5-dimethylfuran-3-one (CHEBI:76247) is a cyclic ketone (CHEBI:3992) |
| 4-hydroxy-2,5-dimethylfuran-3-one (CHEBI:76247) is a enol (CHEBI:33823) |
| 4-hydroxy-2,5-dimethylfuran-3-one (CHEBI:76247) is a furans (CHEBI:24129) |
| 4-hydroxy-2,5-dimethylfuran-3-one (CHEBI:76247) is conjugate acid of 4-hydroxy-2,5-dimethylfuran-3-olate (CHEBI:76248) |
| Incoming Relation(s) |
| furaneol sulfate (CHEBI:232998) has functional parent 4-hydroxy-2,5-dimethylfuran-3-one (CHEBI:76247) |
| 4-hydroxy-2,5-dimethylfuran-3-olate (CHEBI:76248) is conjugate base of 4-hydroxy-2,5-dimethylfuran-3-one (CHEBI:76247) |
| Synonyms | Source |
|---|---|
| 2,5-Dimethyl-3-hydroxy-4-oxo-4,5-dihydrofuran | ChemIDplus |
| 2,5-Dimethyl-4-hydroxy-2,3-dihydrofuran-3-one | ChemIDplus |
| 2,5-Dimethyl-4-hydroxy-3(2H)-furanone | ChemIDplus |
| 4-hydroxy-2,5-dimethyl-3(2H)-furanone | ChEBI |
| Dimethylhydroxy furanone | ChemIDplus |
| Furaneol | ChemIDplus |
| UniProt Name | Source |
|---|---|
| 4-hydroxy-2,5-dimethyl-furan-3(2H)-one | UniProt |
| Manual Xrefs | Databases |
|---|---|
| CPD-10198 | MetaCyc |
| Furaneol | Wikipedia |
| HMDB0040594 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1281357 | Reaxys |
| CAS:3658-77-3 | ChemIDplus |
| Citations |
|---|