EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H6O3 |
| Net Charge | 0 |
| Average Mass | 126.111 |
| Monoisotopic Mass | 126.03169 |
| SMILES | C=C1OC(C)C(=O)C1=O |
| InChI | InChI=1S/C6H6O3/c1-3-5(7)6(8)4(2)9-3/h4H,1H2,2H3 |
| InChIKey | QNXPRMJHYUHYKW-UHFFFAOYSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-methyl-5-methylenefuran-3,4-dione (CHEBI:76246) is a furans (CHEBI:24129) |
| 2-methyl-5-methylenefuran-3,4-dione (CHEBI:76246) is a α-diketone (CHEBI:51869) |
| 2-methyl-5-methylenefuran-3,4-dione (CHEBI:76246) is tautomer of 4-hydroxy-5-methyl-2-methylenefuran-3-one (CHEBI:76245) |
| Incoming Relation(s) |
| 4-hydroxy-5-methyl-2-methylenefuran-3-one (CHEBI:76245) is tautomer of 2-methyl-5-methylenefuran-3,4-dione (CHEBI:76246) |
| IUPAC Name |
|---|
| 2-methyl-5-methylenefuran-3,4(2H,5H)-dione |