EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H6O3 |
| Net Charge | 0 |
| Average Mass | 126.111 |
| Monoisotopic Mass | 126.03169 |
| SMILES | C=C1OC(C)=C(O)C1=O |
| InChI | InChI=1S/C6H6O3/c1-3-5(7)6(8)4(2)9-3/h8H,1H2,2H3 |
| InChIKey | NPMQEIOINVDLMV-UHFFFAOYSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-hydroxy-5-methyl-2-methylenefuran-3-one (CHEBI:76245) is a cyclic ketone (CHEBI:3992) |
| 4-hydroxy-5-methyl-2-methylenefuran-3-one (CHEBI:76245) is a enol (CHEBI:33823) |
| 4-hydroxy-5-methyl-2-methylenefuran-3-one (CHEBI:76245) is a enone (CHEBI:51689) |
| 4-hydroxy-5-methyl-2-methylenefuran-3-one (CHEBI:76245) is a furans (CHEBI:24129) |
| 4-hydroxy-5-methyl-2-methylenefuran-3-one (CHEBI:76245) is tautomer of 2-methyl-5-methylenefuran-3,4-dione (CHEBI:76246) |
| Incoming Relation(s) |
| 2-methyl-5-methylenefuran-3,4-dione (CHEBI:76246) is tautomer of 4-hydroxy-5-methyl-2-methylenefuran-3-one (CHEBI:76245) |
| IUPAC Name |
|---|
| 4-hydroxy-5-methyl-2-methylenefuran-3(2H)-one |
| Synonyms | Source |
|---|---|
| 4-hydroxy-5-methyl-2-methylene-3(2H)-furanone | ChEBI |
| 4-hydroxy-5-methyl-2-methylene-3-furanone | ChEBI |
| HMMF | SUBMITTER |
| UniProt Name | Source |
|---|---|
| 4-hydroxy-5-methyl-2-methylenefuran-3(2H)-one | UniProt |
| Manual Xrefs | Databases |
|---|---|
| CPD-10205 | MetaCyc |
| Registry Numbers | Sources |
|---|---|
| Reaxys:15778938 | Reaxys |
| Citations |
|---|