EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H27N3O10PSR |
| Net Charge | 0 |
| Average Mass (excl. R groups) | 472.429 |
| Monoisotopic Mass (excl. R groups) | 472.11548 |
| SMILES | *C(=O)SCCNC(=O)CCNC(=O)[C@H](O)C(C)(C)COP(=O)(O)OC[C@H](N)C(=O)O |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| O-(S-acylpantetheine-4'-phosphoryl)serine (CHEBI:76242) has functional parent O-(pantetheine-4'-phosphoryl)serine (CHEBI:64896) |
| O-(S-acylpantetheine-4'-phosphoryl)serine (CHEBI:76242) has functional parent D-pantetheine 4'-phosphate (CHEBI:4222) |
| O-(S-acylpantetheine-4'-phosphoryl)serine (CHEBI:76242) is a L-serine derivative (CHEBI:84135) |
| O-(S-acylpantetheine-4'-phosphoryl)serine (CHEBI:76242) is a non-proteinogenic L-α-amino acid (CHEBI:83822) |
| O-(S-acylpantetheine-4'-phosphoryl)serine (CHEBI:76242) is a thioester (CHEBI:51277) |
| Incoming Relation(s) |
| O-(S-acylpantetheine-4'-phosphoryl)serine residue (CHEBI:76241) is substituent group from O-(S-acylpantetheine-4'-phosphoryl)serine (CHEBI:76242) |
| Synonym | Source |
|---|---|
| O-(S-acylpantetheine-4'-phosphoryl)-L-serine | ChEBI |