EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H28N3O9PS |
| Net Charge | 0 |
| Average Mass | 445.431 |
| Monoisotopic Mass | 445.12839 |
| SMILES | CC(C)(COP(=O)(O)OC[C@H](N)C(=O)O)[C@@H](O)C(=O)NCCC(=O)NCCS |
| InChI | InChI=1S/C14H28N3O9PS/c1-14(2,8-26-27(23,24)25-7-9(15)13(21)22)11(19)12(20)17-4-3-10(18)16-5-6-28/h9,11,19,28H,3-8,15H2,1-2H3,(H,16,18)(H,17,20)(H,21,22)(H,23,24)/t9-,11-/m0/s1 |
| InChIKey | JVRAFVIBQUUZKZ-ONGXEEELSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| O-(pantetheine-4'-phosphoryl)serine (CHEBI:64896) has part pantetheine 4'-phosphate group (CHEBI:47982) |
| O-(pantetheine-4'-phosphoryl)serine (CHEBI:64896) is a L-serine derivative (CHEBI:84135) |
| O-(pantetheine-4'-phosphoryl)serine (CHEBI:64896) is a non-proteinogenic L-α-amino acid (CHEBI:83822) |
| Incoming Relation(s) |
| O-(S-acylpantetheine-4'-phosphoryl)serine (CHEBI:76242) has functional parent O-(pantetheine-4'-phosphoryl)serine (CHEBI:64896) |
| O-(pantetheine-4'-phosphoryl)serine residue (CHEBI:64891) is substituent group from O-(pantetheine-4'-phosphoryl)serine (CHEBI:64896) |
| IUPAC Name |
|---|
| O-(hydroxy{[(3R)-3-hydroxy-2,2-dimethyl-4-oxo-4-({3-oxo-3-[(2-sulfanylethyl)amino]propyl}amino)butyl]oxy}phosphoryl)-L-serine |
| Synonym | Source |
|---|---|
| O-(pantetheine-4'-phosphoryl)-L-serine | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 4HH | PDBeChem |
| Citations |
|---|