EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H10Cl2NO2 |
| Net Charge | -1 |
| Average Mass | 295.145 |
| Monoisotopic Mass | 294.00941 |
| SMILES | Cc1ccc(Cl)c(Nc2ccccc2C(=O)[O-])c1Cl |
| InChI | InChI=1S/C14H11Cl2NO2/c1-8-6-7-10(15)13(12(8)16)17-11-5-3-2-4-9(11)14(18)19/h2-7,17H,1H3,(H,18,19)/p-1 |
| InChIKey | SBDNJUWAMKYJOX-UHFFFAOYSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| meclofenamic acid(1−) (CHEBI:76230) is a monocarboxylic acid anion (CHEBI:35757) |
| meclofenamic acid(1−) (CHEBI:76230) is conjugate base of meclofenamic acid (CHEBI:6710) |
| Incoming Relation(s) |
| sodium meclofenamate (anhydrous) (CHEBI:6711) has part meclofenamic acid(1−) (CHEBI:76230) |
| meclofenamic acid (CHEBI:6710) is conjugate acid of meclofenamic acid(1−) (CHEBI:76230) |
| IUPAC Name |
|---|
| 2-[(2,6-dichloro-3-methylphenyl)amino]benzoate |
| Synonym | Source |
|---|---|
| meclofenamate | ChEBI |