EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H11Cl2NO2 |
| Net Charge | 0 |
| Average Mass | 296.153 |
| Monoisotopic Mass | 295.01668 |
| SMILES | Cc1ccc(Cl)c(Nc2ccccc2C(=O)O)c1Cl |
| InChI | InChI=1S/C14H11Cl2NO2/c1-8-6-7-10(15)13(12(8)16)17-11-5-3-2-4-9(11)14(18)19/h2-7,17H,1H3,(H,18,19) |
| InChIKey | SBDNJUWAMKYJOX-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | analgesic An agent capable of relieving pain without the loss of consciousness or without producing anaesthesia. In addition, analgesic is a role played by a compound which is exhibited by a capability to cause a reduction of pain symptoms. EC 1.13.11.34 (arachidonate 5-lipoxygenase) inhibitor A lipoxygenase inhibitor that interferes with the action of arachidonate 5-lipoxygenase (EC 1.13.11.34). EC 1.14.99.1 (prostaglandin-endoperoxide synthase) inhibitor A compound or agent that combines with cyclooxygenases (EC 1.14.99.1) and thereby prevents its substrate-enzyme combination with arachidonic acid and the formation of icosanoids, prostaglandins, and thromboxanes. |
| Applications: | analgesic An agent capable of relieving pain without the loss of consciousness or without producing anaesthesia. In addition, analgesic is a role played by a compound which is exhibited by a capability to cause a reduction of pain symptoms. antirheumatic drug A drug used to treat rheumatoid arthritis. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. non-steroidal anti-inflammatory drug An anti-inflammatory drug that is not a steroid. In addition to anti-inflammatory actions, non-steroidal anti-inflammatory drugs have analgesic, antipyretic, and platelet-inhibitory actions. They act by blocking the synthesis of prostaglandins by inhibiting cyclooxygenase, which converts arachidonic acid to cyclic endoperoxides, precursors of prostaglandins. anticonvulsant A drug used to prevent seizures or reduce their severity. antipyretic A drug that prevents or reduces fever by lowering the body temperature from a raised state. An antipyretic will not affect the normal body temperature if one does not have fever. Antipyretics cause the hypothalamus to override an interleukin-induced increase in temperature. The body will then work to lower the temperature and the result is a reduction in fever. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| meclofenamic acid (CHEBI:6710) has role analgesic (CHEBI:35480) |
| meclofenamic acid (CHEBI:6710) has role anticonvulsant (CHEBI:35623) |
| meclofenamic acid (CHEBI:6710) has role antineoplastic agent (CHEBI:35610) |
| meclofenamic acid (CHEBI:6710) has role antipyretic (CHEBI:35493) |
| meclofenamic acid (CHEBI:6710) has role antirheumatic drug (CHEBI:35842) |
| meclofenamic acid (CHEBI:6710) has role EC 1.13.11.34 (arachidonate 5-lipoxygenase) inhibitor (CHEBI:64964) |
| meclofenamic acid (CHEBI:6710) has role EC 1.14.99.1 (prostaglandin-endoperoxide synthase) inhibitor (CHEBI:35544) |
| meclofenamic acid (CHEBI:6710) has role non-steroidal anti-inflammatory drug (CHEBI:35475) |
| meclofenamic acid (CHEBI:6710) is a aminobenzoic acid (CHEBI:22495) |
| meclofenamic acid (CHEBI:6710) is a organochlorine compound (CHEBI:36683) |
| meclofenamic acid (CHEBI:6710) is a secondary amino compound (CHEBI:50995) |
| meclofenamic acid (CHEBI:6710) is conjugate acid of meclofenamic acid(1−) (CHEBI:76230) |
| Incoming Relation(s) |
| meclofenamic acid(1−) (CHEBI:76230) is conjugate base of meclofenamic acid (CHEBI:6710) |
| IUPAC Name |
|---|
| 2-[(2,6-dichloro-3-methylphenyl)amino]benzoic acid |
| INNs | Source |
|---|---|
| acide méclofénamique | WHO MedNet |
| ácido meclofenámico | WHO MedNet |
| acidum meclofenamicum | ChemIDplus |
| meclofenamic acid | ChemIDplus |
| Synonyms | Source |
|---|---|
| CI-583 | ChemIDplus |
| CL-583 | ChEMBL |
| N-(2,6-dichloro-3-methylphenyl)anthranilic acid | ChemIDplus |
| N-(2,6-dichloro-m-tolyl)anthranilic acid | ChemIDplus |
| N-(3-methyl-2,6-dichlorophenyl)anthranilic acid | ChemIDplus |
| INF 4668 | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 1650 | DrugCentral |
| C07117 | KEGG COMPOUND |
| D02341 | KEGG DRUG |
| DB00939 | DrugBank |
| DE1149045 | Patent |
| HMDB0015074 | HMDB |
| JMS | PDBeChem |
| LSM-3108 | LINCS |
| Meclofenamic_acid | Wikipedia |
| US3313848 | Patent |
| Citations |
|---|