EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:6710 - meclofenamic acid
| Formula | C14H11Cl2NO2 |
| Net Charge | 0 |
| Average Mass | 296.153 |
| Monoisotopic Mass | 295.01668 |
| SMILES | Cc1ccc(Cl)c(Nc2ccccc2C(=O)O)c1Cl |
| InChI | InChI=1S/C14H11Cl2NO2/c1-8-6-7-10(15)13(12(8)16)17-11-5-3-2-4-9(11)14(18)19/h2-7,17H,1H3,(H,18,19) |
| InChIKey | SBDNJUWAMKYJOX-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | EC 1.13.11.34 (arachidonate 5-lipoxygenase) inhibitor A lipoxygenase inhibitor that interferes with the action of arachidonate 5-lipoxygenase (EC 1.13.11.34). EC 1.14.99.1 (prostaglandin-endoperoxide synthase) inhibitor A compound or agent that combines with cyclooxygenases (EC 1.14.99.1) and thereby prevents its substrate-enzyme combination with arachidonic acid and the formation of icosanoids, prostaglandins, and thromboxanes. analgesic An agent capable of relieving pain without the loss of consciousness or without producing anaesthesia. In addition, analgesic is a role played by a compound which is exhibited by a capability to cause a reduction of pain symptoms. |
| Applications: | antirheumatic drug A drug used to treat rheumatoid arthritis. anticonvulsant A drug used to prevent seizures or reduce their severity. non-steroidal anti-inflammatory drug An anti-inflammatory drug that is not a steroid. In addition to anti-inflammatory actions, non-steroidal anti-inflammatory drugs have analgesic, antipyretic, and platelet-inhibitory actions. They act by blocking the synthesis of prostaglandins by inhibiting cyclooxygenase, which converts arachidonic acid to cyclic endoperoxides, precursors of prostaglandins. analgesic An agent capable of relieving pain without the loss of consciousness or without producing anaesthesia. In addition, analgesic is a role played by a compound which is exhibited by a capability to cause a reduction of pain symptoms. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. antipyretic A drug that prevents or reduces fever by lowering the body temperature from a raised state. An antipyretic will not affect the normal body temperature if one does not have fever. Antipyretics cause the hypothalamus to override an interleukin-induced increase in temperature. The body will then work to lower the temperature and the result is a reduction in fever. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| meclofenamic acid (CHEBI:6710) has role analgesic (CHEBI:35480) |
| meclofenamic acid (CHEBI:6710) has role anticonvulsant (CHEBI:35623) |
| meclofenamic acid (CHEBI:6710) has role antineoplastic agent (CHEBI:35610) |
| meclofenamic acid (CHEBI:6710) has role antipyretic (CHEBI:35493) |
| meclofenamic acid (CHEBI:6710) has role antirheumatic drug (CHEBI:35842) |
| meclofenamic acid (CHEBI:6710) has role EC 1.13.11.34 (arachidonate 5-lipoxygenase) inhibitor (CHEBI:64964) |
| meclofenamic acid (CHEBI:6710) has role EC 1.14.99.1 (prostaglandin-endoperoxide synthase) inhibitor (CHEBI:35544) |
| meclofenamic acid (CHEBI:6710) has role non-steroidal anti-inflammatory drug (CHEBI:35475) |
| meclofenamic acid (CHEBI:6710) is a aminobenzoic acid (CHEBI:22495) |
| meclofenamic acid (CHEBI:6710) is a benzoic acids (CHEBI:22723) |
| meclofenamic acid (CHEBI:6710) is a organic molecular entity (CHEBI:50860) |
| meclofenamic acid (CHEBI:6710) is a organochlorine compound (CHEBI:36683) |
| meclofenamic acid (CHEBI:6710) is a secondary amino compound (CHEBI:50995) |
| meclofenamic acid (CHEBI:6710) is conjugate acid of meclofenamic acid(1−) (CHEBI:76230) |
| Incoming Relation(s) |
| meclofenamic acid(1−) (CHEBI:76230) is conjugate base of meclofenamic acid (CHEBI:6710) |
| IUPAC Name |
|---|
| 2-[(2,6-dichloro-3-methylphenyl)amino]benzoic acid |
| INNs | Source |
|---|---|
| acide méclofénamique | WHO MedNet |
| ácido meclofenámico | WHO MedNet |
| acidum meclofenamicum | ChemIDplus |
| meclofenamic acid | ChemIDplus |
| Synonyms | Source |
|---|---|
| CI-583 | ChemIDplus |
| CL-583 | ChEMBL |
| N-(2,6-dichloro-3-methylphenyl)anthranilic acid | ChemIDplus |
| N-(2,6-dichloro-m-tolyl)anthranilic acid | ChemIDplus |
| N-(3-methyl-2,6-dichlorophenyl)anthranilic acid | ChemIDplus |
| INF 4668 | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 1650 | DrugCentral |
| C07117 | KEGG COMPOUND |
| D02341 | KEGG DRUG |
| DB00939 | DrugBank |
| DE1149045 | Patent |
| HMDB0015074 | HMDB |
| JMS | PDBeChem |
| LSM-3108 | LINCS |
| Meclofenamic_acid | Wikipedia |
| US3313848 | Patent |
| Citations |
|---|