EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H11F4N3O2S |
| Net Charge | 0 |
| Average Mass | 385.342 |
| Monoisotopic Mass | 385.05081 |
| SMILES | NS(=O)(=O)c1ccc(-n2nc(C(F)(F)F)cc2-c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C16H11F4N3O2S/c17-11-3-1-10(2-4-11)14-9-15(16(18,19)20)22-23(14)12-5-7-13(8-6-12)26(21,24)25/h1-9H,(H2,21,24,25) |
| InChIKey | TTZNQDOUNXBMJV-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | cyclooxygenase 2 inhibitor A cyclooxygenase inhibitor that interferes with the action of cyclooxygenase 2. non-narcotic analgesic A drug that has principally analgesic, antipyretic and anti-inflammatory actions. Non-narcotic analgesics do not bind to opioid receptors. |
| Applications: | non-narcotic analgesic A drug that has principally analgesic, antipyretic and anti-inflammatory actions. Non-narcotic analgesics do not bind to opioid receptors. non-steroidal anti-inflammatory drug An anti-inflammatory drug that is not a steroid. In addition to anti-inflammatory actions, non-steroidal anti-inflammatory drugs have analgesic, antipyretic, and platelet-inhibitory actions. They act by blocking the synthesis of prostaglandins by inhibiting cyclooxygenase, which converts arachidonic acid to cyclic endoperoxides, precursors of prostaglandins. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| mavacoxib (CHEBI:76207) has role cyclooxygenase 2 inhibitor (CHEBI:50629) |
| mavacoxib (CHEBI:76207) has role non-narcotic analgesic (CHEBI:35481) |
| mavacoxib (CHEBI:76207) has role non-steroidal anti-inflammatory drug (CHEBI:35475) |
| mavacoxib (CHEBI:76207) is a organofluorine compound (CHEBI:37143) |
| mavacoxib (CHEBI:76207) is a pyrazoles (CHEBI:26410) |
| mavacoxib (CHEBI:76207) is a sulfonamide (CHEBI:35358) |
| IUPAC Name |
|---|
| 4-[5-(4-fluorophenyl)-3-(trifluoromethyl)-1H-pyrazol-1-yl]benzenesulfonamide |
| INNs | Source |
|---|---|
| mavacoxib | WHO MedNet |
| mavacoxib | WHO MedNet |
| mavacoxib | KEGG DRUG |
| mavacoxibum | WHO MedNet |
| Synonyms | Source |
|---|---|
| PHA 739,521 | ChemIDplus |
| PHA-739521 | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 1875 | VSDB |
| D04863 | KEGG DRUG |
| Mavacoxib | Wikipedia |
| US2005222240 | Patent |
| WO2005025510 | Patent |
| WO2006024930 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:7726438 | Reaxys |
| CAS:170569-88-7 | KEGG DRUG |
| CAS:170569-88-7 | ChemIDplus |
| Citations |
|---|