EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H22O8 |
| Net Charge | 0 |
| Average Mass | 390.388 |
| Monoisotopic Mass | 390.13147 |
| SMILES | OC[C@H]1O[C@@H](Oc2cc(O)cc(/C=C\c3ccc(O)cc3)c2)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C20H22O8/c21-10-16-17(24)18(25)19(26)20(28-16)27-15-8-12(7-14(23)9-15)2-1-11-3-5-13(22)6-4-11/h1-9,16-26H,10H2/b2-1-/t16-,17-,18+,19-,20-/m1/s1 |
| InChIKey | HSTZMXCBWJGKHG-BUFXCDORSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cis-piceid (CHEBI:76155) has functional parent cis-resveratrol (CHEBI:36002) |
| cis-piceid (CHEBI:76155) has role metabolite (CHEBI:25212) |
| cis-piceid (CHEBI:76155) is a monosaccharide derivative (CHEBI:63367) |
| cis-piceid (CHEBI:76155) is a polyphenol (CHEBI:26195) |
| cis-piceid (CHEBI:76155) is a stilbenoid (CHEBI:26776) |
| cis-piceid (CHEBI:76155) is a β-D-glucoside (CHEBI:22798) |
| IUPAC Name |
|---|
| 3-hydroxy-5-[(Z)-2-(4-hydroxyphenyl)ethenyl]phenyl β-D-glucopyranoside |
| Synonyms | Source |
|---|---|
| cis-resveratrol 3-β-D-glucoside | ChEBI |
| cis-resveratrol 3-O-β-D-glucoside | ChEBI |
| cis-resveratrol 3-β-glucoside | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:7417618 | Reaxys |