EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H12O3 |
| Net Charge | 0 |
| Average Mass | 228.247 |
| Monoisotopic Mass | 228.07864 |
| SMILES | Oc1ccc(/C=C\c2cc(O)cc(O)c2)cc1 |
| InChI | InChI=1S/C14H12O3/c15-12-5-3-10(4-6-12)1-2-11-7-13(16)9-14(17)8-11/h1-9,15-17H/b2-1- |
| InChIKey | LUKBXSAWLPMMSZ-UPHRSURJSA-N |
| Roles Classification |
|---|
| Chemical Role: | antioxidant A substance that opposes oxidation or inhibits reactions brought about by dioxygen or peroxides. |
| Biological Roles: | glioma-associated oncogene inhibitor An inhibitor of any of the glioma-associated oncogene (GLI) proteins. phytoalexin A toxin made by a plant that acts against an organism attacking it. |
| Application: | geroprotector Any compound that supports healthy aging, slows the biological aging process, or extends lifespan. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cis-resveratrol (CHEBI:36002) is a resveratrol (CHEBI:27881) |
| Incoming Relation(s) |
| (+)-cis-ε-viniferin (CHEBI:76142) has functional parent cis-resveratrol (CHEBI:36002) |
| (−)-cis-ε-viniferin (CHEBI:76139) has functional parent cis-resveratrol (CHEBI:36002) |
| (2R,3R)-cis-δ-viniferin (CHEBI:76148) has functional parent cis-resveratrol (CHEBI:36002) |
| (2R,3S)-cis-ε-viniferin (CHEBI:76145) has functional parent cis-resveratrol (CHEBI:36002) |
| (2S,3R)-cis-ε-viniferin (CHEBI:76146) has functional parent cis-resveratrol (CHEBI:36002) |
| (2S,3S)-cis-δ-viniferin (CHEBI:76149) has functional parent cis-resveratrol (CHEBI:36002) |
| cis-piceid (CHEBI:76155) has functional parent cis-resveratrol (CHEBI:36002) |
| cis-resveratrol 3-O-glucuronide (CHEBI:86971) has functional parent cis-resveratrol (CHEBI:36002) |
| IUPAC Name |
|---|
| 5-[(1Z)-2-(4-hydroxyphenyl)ethenyl]benzene-1,3-diol |
| Synonyms | Source |
|---|---|
| 5-[(Z)-2-(4-hydroxyphenyl)vinyl]benzene-1,3-diol | ChEBI |
| cis-3,4',5-trihydroxystilbene | ChEBI |
| cis-3,5,4'-trihydroxystilbene | ChEBI |
| (Z)-3,4',5-trihydroxystilbene | ChEBI |
| (Z)-3,5,4'-trihydroxystilbene | ChEBI |
| (Z)-resveratrol | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:7204499 | Reaxys |