EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H20O5S |
| Net Charge | 0 |
| Average Mass | 336.409 |
| Monoisotopic Mass | 336.10314 |
| SMILES | CC1(C)OC(=O)C(OCC2CC2)=C1c1ccc(S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C17H20O5S/c1-17(2)14(12-6-8-13(9-7-12)23(3,19)20)15(16(18)22-17)21-10-11-4-5-11/h6-9,11H,4-5,10H2,1-3H3 |
| InChIKey | FULAPETWGIGNMT-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | cyclooxygenase 2 inhibitor A cyclooxygenase inhibitor that interferes with the action of cyclooxygenase 2. non-narcotic analgesic A drug that has principally analgesic, antipyretic and anti-inflammatory actions. Non-narcotic analgesics do not bind to opioid receptors. |
| Applications: | non-narcotic analgesic A drug that has principally analgesic, antipyretic and anti-inflammatory actions. Non-narcotic analgesics do not bind to opioid receptors. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. non-steroidal anti-inflammatory drug An anti-inflammatory drug that is not a steroid. In addition to anti-inflammatory actions, non-steroidal anti-inflammatory drugs have analgesic, antipyretic, and platelet-inhibitory actions. They act by blocking the synthesis of prostaglandins by inhibiting cyclooxygenase, which converts arachidonic acid to cyclic endoperoxides, precursors of prostaglandins. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| firocoxib (CHEBI:76136) has role antineoplastic agent (CHEBI:35610) |
| firocoxib (CHEBI:76136) has role cyclooxygenase 2 inhibitor (CHEBI:50629) |
| firocoxib (CHEBI:76136) has role non-narcotic analgesic (CHEBI:35481) |
| firocoxib (CHEBI:76136) has role non-steroidal anti-inflammatory drug (CHEBI:35475) |
| firocoxib (CHEBI:76136) is a butenolide (CHEBI:50523) |
| firocoxib (CHEBI:76136) is a cyclopropanes (CHEBI:51454) |
| firocoxib (CHEBI:76136) is a enol ether (CHEBI:47985) |
| firocoxib (CHEBI:76136) is a sulfone (CHEBI:35850) |
| IUPAC Name |
|---|
| 3-(cyclopropylmethoxy)-5,5-dimethyl-4-[4-(methylsulfonyl)phenyl]furan-2(5H)-one |
| INNs | Source |
|---|---|
| firocoxib | KEGG DRUG |
| firocoxib | WHO MedNet |
| firocoxibum | WHO MedNet |
| firocoxib | WHO MedNet |
| Synonym | Source |
|---|---|
| 3-(Cyclopropylmethoxy)-4-(4-methylsulfonylphenyl)-5,5-dimethylfuranone | ChemIDplus |
| Brand Name | Source |
|---|---|
| Equioxx | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| D03712 | KEGG DRUG |
| C18363 | KEGG COMPOUND |
| WO2007041499 | Patent |
| Firocoxib | Wikipedia |
| WO2011104161 | Patent |
| US2011118243 | Patent |
| 1774 | VSDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8335837 | Reaxys |
| CAS:189954-96-9 | KEGG COMPOUND |
| CAS:189954-96-9 | ChemIDplus |
| Citations |
|---|