EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H16N2O |
| Net Charge | 0 |
| Average Mass | 288.350 |
| Monoisotopic Mass | 288.12626 |
| SMILES | O=C(Cc1ccc(-c2ccccc2)cc1)Nc1ccccn1 |
| InChI | InChI=1S/C19H16N2O/c22-19(21-18-8-4-5-13-20-18)14-15-9-11-17(12-10-15)16-6-2-1-3-7-16/h1-13H,14H2,(H,20,21,22) |
| InChIKey | PWHROYKAGRUWDQ-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | non-narcotic analgesic A drug that has principally analgesic, antipyretic and anti-inflammatory actions. Non-narcotic analgesics do not bind to opioid receptors. |
| Applications: | antipyretic A drug that prevents or reduces fever by lowering the body temperature from a raised state. An antipyretic will not affect the normal body temperature if one does not have fever. Antipyretics cause the hypothalamus to override an interleukin-induced increase in temperature. The body will then work to lower the temperature and the result is a reduction in fever. non-narcotic analgesic A drug that has principally analgesic, antipyretic and anti-inflammatory actions. Non-narcotic analgesics do not bind to opioid receptors. non-steroidal anti-inflammatory drug An anti-inflammatory drug that is not a steroid. In addition to anti-inflammatory actions, non-steroidal anti-inflammatory drugs have analgesic, antipyretic, and platelet-inhibitory actions. They act by blocking the synthesis of prostaglandins by inhibiting cyclooxygenase, which converts arachidonic acid to cyclic endoperoxides, precursors of prostaglandins. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| difenpiramide (CHEBI:76130) has functional parent biphenyl-4-ylacetic acid (CHEBI:31597) |
| difenpiramide (CHEBI:76130) has role antipyretic (CHEBI:35493) |
| difenpiramide (CHEBI:76130) has role non-narcotic analgesic (CHEBI:35481) |
| difenpiramide (CHEBI:76130) has role non-steroidal anti-inflammatory drug (CHEBI:35475) |
| difenpiramide (CHEBI:76130) is a biphenyls (CHEBI:22888) |
| difenpiramide (CHEBI:76130) is a monocarboxylic acid amide (CHEBI:29347) |
| difenpiramide (CHEBI:76130) is a pyridines (CHEBI:26421) |
| IUPAC Name |
|---|
| 2-(biphenyl-4-yl)-N-(pyridin-2-yl)acetamide |
| Synonyms | Source |
|---|---|
| 2-Biphenylyl-N-pyridylacetamide | ChemIDplus |
| Diphenpyramide | ChemIDplus |
| N-2-Pyridinyl-(1,1'-biphenyl)-4-acetamide | ChemIDplus |
| N-Pyridin-2-yl(1,1'-biphenyl)-4-acetamide | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 919 | DrugCentral |
| C17720 | KEGG COMPOUND |
| Difenpiramide | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:483768 | Reaxys |
| CAS:51484-40-3 | KEGG DRUG |
| CAS:51484-40-3 | ChemIDplus |
| CAS:51484-40-3 | KEGG COMPOUND |
| Citations |
|---|