EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H14O3 |
| Net Charge | 0 |
| Average Mass | 254.285 |
| Monoisotopic Mass | 254.09429 |
| SMILES | C[C@H](C(=O)O)c1cccc(C(=O)c2ccccc2)c1 |
| InChI | InChI=1S/C16H14O3/c1-11(16(18)19)13-8-5-9-14(10-13)15(17)12-6-3-2-4-7-12/h2-11H,1H3,(H,18,19)/t11-/m0/s1 |
| InChIKey | DKYWVDODHFEZIM-NSHDSACASA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | cyclooxygenase 2 inhibitor A cyclooxygenase inhibitor that interferes with the action of cyclooxygenase 2. cyclooxygenase 1 inhibitor A cyclooxygenase inhibitor that interferes with the action of cyclooxygenase 1. non-narcotic analgesic A drug that has principally analgesic, antipyretic and anti-inflammatory actions. Non-narcotic analgesics do not bind to opioid receptors. |
| Applications: | non-narcotic analgesic A drug that has principally analgesic, antipyretic and anti-inflammatory actions. Non-narcotic analgesics do not bind to opioid receptors. non-steroidal anti-inflammatory drug An anti-inflammatory drug that is not a steroid. In addition to anti-inflammatory actions, non-steroidal anti-inflammatory drugs have analgesic, antipyretic, and platelet-inhibitory actions. They act by blocking the synthesis of prostaglandins by inhibiting cyclooxygenase, which converts arachidonic acid to cyclic endoperoxides, precursors of prostaglandins. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dexketoprofen (CHEBI:76128) has functional parent (S)-hydratropic acid (CHEBI:48527) |
| dexketoprofen (CHEBI:76128) has role cyclooxygenase 1 inhibitor (CHEBI:50630) |
| dexketoprofen (CHEBI:76128) has role cyclooxygenase 2 inhibitor (CHEBI:50629) |
| dexketoprofen (CHEBI:76128) has role non-narcotic analgesic (CHEBI:35481) |
| dexketoprofen (CHEBI:76128) has role non-steroidal anti-inflammatory drug (CHEBI:35475) |
| dexketoprofen (CHEBI:76128) is a benzophenones (CHEBI:22726) |
| dexketoprofen (CHEBI:76128) is a monocarboxylic acid (CHEBI:25384) |
| IUPAC Name |
|---|
| (2S)-2-(3-benzoylphenyl)propanoic acid |
| INN | Source |
|---|---|
| dexketoprofen | KEGG DRUG |
| Synonyms | Source |
|---|---|
| (+)-3-Benzoylhydratropic acid | ChemIDplus |
| (+)-Ketoprofen | ChemIDplus |
| (S)-3-Benzoyl-alpha-methylbenzeneacetic acid | ChemIDplus |
| (S)-Ketoprofen | ChemIDplus |
| (+)-(S)-m-Benzoylhydratropic acid | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 833 | DrugCentral |
| D07269 | KEGG DRUG |
| Dexketoprofen | Wikipedia |
| HMDB0041873 | HMDB |
| LSM-5547 | LINCS |
| WO2005046575 | Patent |
| WO2008115572 | Patent |
| WO2008150324 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5271646 | Reaxys |
| CAS:22161-81-5 | KEGG DRUG |
| CAS:22161-81-5 | ChemIDplus |
| Citations |
|---|