EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H14O3 |
| Net Charge | 0 |
| Average Mass | 254.285 |
| Monoisotopic Mass | 254.09429 |
| SMILES | C[C@H](C(=O)O)c1cccc(C(=O)c2ccccc2)c1 |
| InChI | InChI=1S/C16H14O3/c1-11(16(18)19)13-8-5-9-14(10-13)15(17)12-6-3-2-4-7-12/h2-11H,1H3,(H,18,19)/t11-/m0/s1 |
| InChIKey | DKYWVDODHFEZIM-NSHDSACASA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | non-narcotic analgesic A drug that has principally analgesic, antipyretic and anti-inflammatory actions. Non-narcotic analgesics do not bind to opioid receptors. analgesic An agent capable of relieving pain without the loss of consciousness or without producing anaesthesia. In addition, analgesic is a role played by a compound which is exhibited by a capability to cause a reduction of pain symptoms. cyclooxygenase 2 inhibitor A cyclooxygenase inhibitor that interferes with the action of cyclooxygenase 2. cyclooxygenase 1 inhibitor A cyclooxygenase inhibitor that interferes with the action of cyclooxygenase 1. |
| Applications: | non-narcotic analgesic A drug that has principally analgesic, antipyretic and anti-inflammatory actions. Non-narcotic analgesics do not bind to opioid receptors. non-steroidal anti-inflammatory drug An anti-inflammatory drug that is not a steroid. In addition to anti-inflammatory actions, non-steroidal anti-inflammatory drugs have analgesic, antipyretic, and platelet-inhibitory actions. They act by blocking the synthesis of prostaglandins by inhibiting cyclooxygenase, which converts arachidonic acid to cyclic endoperoxides, precursors of prostaglandins. analgesic An agent capable of relieving pain without the loss of consciousness or without producing anaesthesia. In addition, analgesic is a role played by a compound which is exhibited by a capability to cause a reduction of pain symptoms. vulnerary A drug used in treating and healing of wounds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dexketoprofen (CHEBI:76128) has functional parent (S)-hydratropic acid (CHEBI:48527) |
| dexketoprofen (CHEBI:76128) has role analgesic (CHEBI:35480) |
| dexketoprofen (CHEBI:76128) has role cyclooxygenase 1 inhibitor (CHEBI:50630) |
| dexketoprofen (CHEBI:76128) has role cyclooxygenase 2 inhibitor (CHEBI:50629) |
| dexketoprofen (CHEBI:76128) has role non-narcotic analgesic (CHEBI:35481) |
| dexketoprofen (CHEBI:76128) has role non-steroidal anti-inflammatory drug (CHEBI:35475) |
| dexketoprofen (CHEBI:76128) has role vulnerary (CHEBI:73336) |
| dexketoprofen (CHEBI:76128) is a benzophenones (CHEBI:22726) |
| dexketoprofen (CHEBI:76128) is a monocarboxylic acid (CHEBI:25384) |
| IUPAC Name |
|---|
| (2S)-2-(3-benzoylphenyl)propanoic acid |
| INNs | Source |
|---|---|
| dexketoprofen | KEGG DRUG |
| dexketoprofene | WHO MedNet |
| dexketoprofeno | WHO MedNet |
| Synonyms | Source |
|---|---|
| (+)-3-Benzoylhydratropic acid | ChemIDplus |
| Arveles | ChEMBL |
| (+)-Ketoprofen | ChemIDplus |
| Ketoprofen, (s)- | ChEMBL |
| (S)-3-Benzoyl-alpha-methylbenzeneacetic acid | ChemIDplus |
| (S)-Ketoprofen | ChemIDplus |
| Brand Name | Source |
|---|---|
| Keral | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| 833 | DrugCentral |
| D07269 | KEGG DRUG |
| Dexketoprofen | Wikipedia |
| HMDB0041873 | HMDB |
| LSM-5547 | LINCS |
| WO2005046575 | Patent |
| WO2008115572 | Patent |
| WO2008150324 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5271646 | Reaxys |
| CAS:22161-81-5 | KEGG DRUG |
| CAS:22161-81-5 | ChemIDplus |
| Citations |
|---|