EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H13ClFN3O3S |
| Net Charge | 0 |
| Average Mass | 381.816 |
| Monoisotopic Mass | 381.03502 |
| SMILES | COc1ccc(-c2c(Cl)ncn2-c2ccc(S(N)(=O)=O)cc2)cc1F |
| InChI | InChI=1S/C16H13ClFN3O3S/c1-24-14-7-2-10(8-13(14)18)15-16(17)20-9-21(15)11-3-5-12(6-4-11)25(19,22)23/h2-9H,1H3,(H2,19,22,23) |
| InChIKey | KYXDNECMRLFQMZ-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | cyclooxygenase 2 inhibitor A cyclooxygenase inhibitor that interferes with the action of cyclooxygenase 2. |
| Application: | non-steroidal anti-inflammatory drug An anti-inflammatory drug that is not a steroid. In addition to anti-inflammatory actions, non-steroidal anti-inflammatory drugs have analgesic, antipyretic, and platelet-inhibitory actions. They act by blocking the synthesis of prostaglandins by inhibiting cyclooxygenase, which converts arachidonic acid to cyclic endoperoxides, precursors of prostaglandins. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cimicoxib (CHEBI:76127) has role cyclooxygenase 2 inhibitor (CHEBI:50629) |
| cimicoxib (CHEBI:76127) has role non-steroidal anti-inflammatory drug (CHEBI:35475) |
| cimicoxib (CHEBI:76127) is a aromatic ether (CHEBI:35618) |
| cimicoxib (CHEBI:76127) is a imidazoles (CHEBI:24780) |
| cimicoxib (CHEBI:76127) is a organochlorine compound (CHEBI:36683) |
| cimicoxib (CHEBI:76127) is a organofluorine compound (CHEBI:37143) |
| cimicoxib (CHEBI:76127) is a sulfonamide (CHEBI:35358) |
| IUPAC Name |
|---|
| 4-[4-chloro-5-(3-fluoro-4-methoxyphenyl)-1H-imidazol-1-yl]benzenesulfonamide |
| INN | Source |
|---|---|
| cimicoxib | ChemIDplus |
| Synonym | Source |
|---|---|
| UR-8880 | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| WO2005020895 | Patent |
| WO2005021004 | Patent |
| Cimicoxib | Wikipedia |
| NZ556707 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:9505967 | Reaxys |
| CAS:265114-23-6 | ChemIDplus |
| Citations |
|---|