EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H7ClNO2 |
| Net Charge | -1 |
| Average Mass | 184.602 |
| Monoisotopic Mass | 184.01708 |
| SMILES | N[C@H](C(=O)[O-])c1ccccc1Cl |
| InChI | InChI=1S/C8H8ClNO2/c9-6-4-2-1-3-5(6)7(10)8(11)12/h1-4,7H,10H2,(H,11,12)/p-1/t7-/m0/s1 |
| InChIKey | LMIZLNPFTRQPSF-ZETCQYMHSA-M |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-(2-chlorophenyl)-L-glycine zwitterion (CHEBI:760915) has functional parent L-α-phenylglycine zwitterion (CHEBI:136765) |
| 2-(2-chlorophenyl)-L-glycine zwitterion (CHEBI:760915) is a L-α-amino acid zwitterion (CHEBI:59869) |
| 2-(2-chlorophenyl)-L-glycine zwitterion (CHEBI:760915) is a monochlorobenzenes (CHEBI:83403) |
| 2-(2-chlorophenyl)-L-glycine zwitterion (CHEBI:760915) is a non-proteinogenic α-amino acid (CHEBI:83925) |
| Incoming Relation(s) |
| N-acetyl-2-(2-chlorophenyl)-L-glycinate (CHEBI:760916) has functional parent 2-(2-chlorophenyl)-L-glycine zwitterion (CHEBI:760915) |
| UniProt Name | Source |
|---|---|
| 2-(2-chlorophenyl)-L-glycine | UniProt |