EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H13N4O2S |
| Net Charge | -1 |
| Average Mass | 277.329 |
| Monoisotopic Mass | 277.07647 |
| SMILES | Cc1cc(C)nc([N-]S(=O)(=O)c2ccc(N)cc2)n1 |
| InChI | InChI=1S/C12H13N4O2S/c1-8-7-9(2)15-12(14-8)16-19(17,18)11-5-3-10(13)4-6-11/h3-7H,13H2,1-2H3/q-1 |
| InChIKey | HAXNAXUEIPRPPE-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| sulfamethazine(1-) (CHEBI:760870) is a pyrimidines (CHEBI:39447) |
| sulfamethazine(1-) (CHEBI:760870) is a sulfonamide (CHEBI:35358) |
| sulfamethazine(1-) (CHEBI:760870) is a sulfonamide antibiotic (CHEBI:87228) |
| sulfamethazine(1-) (CHEBI:760870) is conjugate base of sulfamethazine (CHEBI:102265) |
| Incoming Relation(s) |
| N-acetylsulfamethazine(1-) (CHEBI:760871) has functional parent sulfamethazine(1-) (CHEBI:760870) |
| UniProt Name | Source |
|---|---|
| sulfamethazine | UniProt |