EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H23N2S |
| Net Charge | +1 |
| Average Mass | 299.463 |
| Monoisotopic Mass | 299.15765 |
| SMILES | Cc1ccc(Sc2ccccc2N2CC[NH2+]CC2)c(C)c1 |
| InChI | InChI=1S/C18H22N2S/c1-14-7-8-17(15(2)13-14)21-18-6-4-3-5-16(18)20-11-9-19-10-12-20/h3-8,13,19H,9-12H2,1-2H3/p+1 |
| InChIKey | YQNWZWMKLDQSAC-UHFFFAOYSA-O |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| vortioxetine(1+) (CHEBI:76017) is a ammonium ion derivative (CHEBI:35274) |
| vortioxetine(1+) (CHEBI:76017) is a organic cation (CHEBI:25697) |
| vortioxetine(1+) (CHEBI:76017) is conjugate acid of vortioxetine (CHEBI:76016) |
| Incoming Relation(s) |
| vortioxetine hydrobromide (CHEBI:76015) has part vortioxetine(1+) (CHEBI:76017) |
| vortioxetine (CHEBI:76016) is conjugate base of vortioxetine(1+) (CHEBI:76017) |
| IUPAC Name |
|---|
| 4-{2-[(2,4-dimethylphenyl)sulfanyl]phenyl}piperazin-1-ium |
| Synonym | Source |
|---|---|
| vortioxetine cation | ChEBI |