EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H22N2S.HBr |
| Net Charge | 0 |
| Average Mass | 379.367 |
| Monoisotopic Mass | 378.07653 |
| SMILES | Br.Cc1ccc(Sc2ccccc2N2CCNCC2)c(C)c1 |
| InChI | InChI=1S/C18H22N2S.BrH/c1-14-7-8-17(15(2)13-14)21-18-6-4-3-5-16(18)20-11-9-19-10-12-20;/h3-8,13,19H,9-12H2,1-2H3;1H |
| InChIKey | VNGRUFUIHGGOOM-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | serotonergic antagonist Drugs that bind to but do not activate serotonin receptors, thereby blocking the actions of serotonin or serotonergic agonists. serotonergic agonist An agent that has an affinity for serotonin receptors and is able to mimic the effects of serotonin by stimulating the physiologic activity at the cell receptors. Serotonin agonists are used as antidepressants, anxiolytics, and in the treatment of migraine disorders. |
| Applications: | serotonergic antagonist Drugs that bind to but do not activate serotonin receptors, thereby blocking the actions of serotonin or serotonergic agonists. anxiolytic drug Anxiolytic drugs are agents that alleviate anxiety, tension, and anxiety disorders, promote sedation, and have a calming effect without affecting clarity of consciousness or neurologic conditions. serotonergic agonist An agent that has an affinity for serotonin receptors and is able to mimic the effects of serotonin by stimulating the physiologic activity at the cell receptors. Serotonin agonists are used as antidepressants, anxiolytics, and in the treatment of migraine disorders. antidepressant Antidepressants are mood-stimulating drugs used primarily in the treatment of affective disorders and related conditions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| vortioxetine hydrobromide (CHEBI:76015) has part vortioxetine(1+) (CHEBI:76017) |
| vortioxetine hydrobromide (CHEBI:76015) has role antidepressant (CHEBI:35469) |
| vortioxetine hydrobromide (CHEBI:76015) has role anxiolytic drug (CHEBI:35474) |
| vortioxetine hydrobromide (CHEBI:76015) has role serotonergic agonist (CHEBI:35941) |
| vortioxetine hydrobromide (CHEBI:76015) has role serotonergic antagonist (CHEBI:48279) |
| vortioxetine hydrobromide (CHEBI:76015) is a hydrobromide (CHEBI:48367) |
| IUPAC Names |
|---|
| 1-{2-[(2,4-dimethylphenyl)sulfanyl]phenyl}piperazine hydrobromide |
| 4-{2-[(2,4-dimethylphenyl)sulfanyl]phenyl}piperazin-1-ium bromide |
| Synonyms | Source |
|---|---|
| 1-(2-((2,4-Dimethylphenyl)sulfanyl)phenyl)piperazine monohydrobromide | ChemIDplus |
| vortioxetine monohydrobromide | ChemIDplus |
| Brand Name | Source |
|---|---|
| Brintellix | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| D10185 | KEGG DRUG |
| Vortioxetine | Wikipedia |
| WO2007144005 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:15607074 | Reaxys |
| CAS:960203-27-4 | KEGG DRUG |
| CAS:960203-27-4 | ChemIDplus |