EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H25ClFN5O3.2C4H4O4 |
| Net Charge | 0 |
| Average Mass | 718.091 |
| Monoisotopic Mass | 717.18491 |
| SMILES | CN(C)C/C=C/C(=O)Nc1cc2c(Nc3ccc(F)c(Cl)c3)ncnc2cc1O[C@H]1CCOC1.O=C(O)/C=C\C(=O)O.O=C(O)/C=C\C(=O)O |
| InChI | InChI=1S/C24H25ClFN5O3.2C4H4O4/c1-31(2)8-3-4-23(32)30-21-11-17-20(12-22(21)34-16-7-9-33-13-16)27-14-28-24(17)29-15-5-6-19(26)18(25)10-15;2*5-3(6)1-2-4(7)8/h3-6,10-12,14,16H,7-9,13H2,1-2H3,(H,30,32)(H,27,28,29);2*1-2H,(H,5,6)(H,7,8)/b4-3+;2*2-1-/t16-;;/m0../s1 |
| InChIKey | USNRYVNRPYXCSP-JUGPPOIOSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | tyrosine kinase inhibitor Any protein kinase inhibitor that interferes with the action of tyrosine kinase. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| afatinib dimaleate (CHEBI:76003) has part afatinib (CHEBI:61390) |
| afatinib dimaleate (CHEBI:76003) has role antineoplastic agent (CHEBI:35610) |
| afatinib dimaleate (CHEBI:76003) has role tyrosine kinase inhibitor (CHEBI:38637) |
| afatinib dimaleate (CHEBI:76003) is a maleate salt (CHEBI:50221) |
| IUPAC Name |
|---|
| (2E)-N-{4-[(3-chloro-4-fluorophenyl)amino]-7-[(3S)-tetrahydrofuran-3-yloxy]quinazolin-6-yl}-4-(dimethylamino)but-2-enamide di[(2Z)-but-2-enedioate] |
| Synonyms | Source |
|---|---|
| Afatinib maleate | KEGG DRUG |
| BIBW 2992MA2 | ChemIDplus |
| Brand Name | Source |
|---|---|
| Gilotrif | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| D09733 | KEGG DRUG |
| DB08916 | DrugBank |
| Afatinib | Wikipedia |
| WO2013052157 | Patent |
| WO2012121764 | Patent |
| US2005085495 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:14383062 | Reaxys |
| CAS:850140-73-7 | ChemIDplus |
| Citations |
|---|