EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H32O5 |
| Net Charge | 0 |
| Average Mass | 352.471 |
| Monoisotopic Mass | 352.22497 |
| SMILES | CCCCCC(=O)/C=C/[C@@H]1[C@@H](C/C=C\CCCC(=O)O)[C@@H](O)C[C@H]1O |
| InChI | InChI=1S/C20H32O5/c1-2-3-6-9-15(21)12-13-17-16(18(22)14-19(17)23)10-7-4-5-8-11-20(24)25/h4,7,12-13,16-19,22-23H,2-3,5-6,8-11,14H2,1H3,(H,24,25)/b7-4-,13-12+/t16-,17-,18+,19-/m1/s1 |
| InChIKey | LOLJEILMPWPILA-AMFHKTBMSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 15-oxoprostaglandin F2α (CHEBI:28442) has functional parent prostaglandin F2α (CHEBI:15553) |
| 15-oxoprostaglandin F2α (CHEBI:28442) is a prostaglandins Fα (CHEBI:36066) |
| 15-oxoprostaglandin F2α (CHEBI:28442) is conjugate acid of 15-oxoprostaglandin F2α(1−) (CHEBI:133409) |
| Incoming Relation(s) |
| 13,14-dihydro-15-oxo-20-carboxy-PGF2α (CHEBI:73974) has functional parent 15-oxoprostaglandin F2α (CHEBI:28442) |
| 15-oxoprostaglandin F2α(1−) (CHEBI:133409) is conjugate base of 15-oxoprostaglandin F2α (CHEBI:28442) |
| IUPAC Name |
|---|
| (5Z,13E)-9α,11α-dihydroxy-15-oxoprosta-5,13-dien-1-oic acid |
| Synonyms | Source |
|---|---|
| 15-Keto-PGF2a | KEGG COMPOUND |
| 15-Keto-PGF2alpha | KEGG COMPOUND |
| 15-Keto-prostaglandin F2a | KEGG COMPOUND |
| 15-Keto-prostaglandin F2alpha | KEGG COMPOUND |
| 15-Ketoprostaglandin F2alpha | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| C05960 | KEGG COMPOUND |
| LMFA03010026 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2951600 | Reaxys |
| CAS:35850-13-6 | ChemIDplus |
| Citations |
|---|