EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H32O7 |
| Net Charge | 0 |
| Average Mass | 384.469 |
| Monoisotopic Mass | 384.21480 |
| SMILES | O=C(O)CCC/C=C\C[C@@H]1[C@@H](CCC(=O)CCCCC(=O)O)[C@H](O)C[C@@H]1O |
| InChI | InChI=1S/C20H32O7/c21-14(7-5-6-10-20(26)27)11-12-16-15(17(22)13-18(16)23)8-3-1-2-4-9-19(24)25/h1,3,15-18,22-23H,2,4-13H2,(H,24,25)(H,26,27)/b3-1-/t15-,16-,17+,18-/m1/s1 |
| InChIKey | ZOMSIHPATHBPLP-WBIFQALJSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 13,14-dihydro-15-oxo-20-carboxy-PGF2α (CHEBI:73974) has functional parent 15-oxoprostaglandin F2α (CHEBI:28442) |
| 13,14-dihydro-15-oxo-20-carboxy-PGF2α (CHEBI:73974) has role metabolite (CHEBI:25212) |
| 13,14-dihydro-15-oxo-20-carboxy-PGF2α (CHEBI:73974) is a ketone (CHEBI:17087) |
| 13,14-dihydro-15-oxo-20-carboxy-PGF2α (CHEBI:73974) is a oxo dicarboxylic acid (CHEBI:36145) |
| 13,14-dihydro-15-oxo-20-carboxy-PGF2α (CHEBI:73974) is a prostaglandins Fα (CHEBI:36066) |
| IUPAC Name |
|---|
| (5Z,9α,11α)-9,11-dihydroxy-15-oxoprost-5-ene-1,20-dioic acid |
| Synonyms | Source |
|---|---|
| 19-carboxy-13,14-dihydro-20-nor-15-oxoprostaglandin F2α | ChEBI |
| 19-carboxy-13,14-dihydro-20-nor-15-oxo-PGF2α | ChEBI |