EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H16F9N5O |
| Net Charge | 0 |
| Average Mass | 453.309 |
| Monoisotopic Mass | 453.12111 |
| SMILES | C[C@@H](Nc1nc(N[C@H](C)C(F)(F)F)nc(C2=C(F)[C@H](O)C(F)(F)CC2)n1)C(F)(F)F |
| InChI | InChI=1S/C15H16F9N5O/c1-5(14(19,20)21)25-11-27-10(7-3-4-13(17,18)9(30)8(7)16)28-12(29-11)26-6(2)15(22,23)24/h5-6,9,30H,3-4H2,1-2H3,(H2,25,26,27,28,29)/t5-,6-,9+/m1/s1 |
| InChIKey | CECMHVJGNAFHKN-KCRUCZTKSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ranosidenib (CHEBI:759987) has role antineoplastic agent (CHEBI:35610) |
| ranosidenib (CHEBI:759987) is a 1,3,5-triazines (CHEBI:26588) |
| INN | Source |
|---|---|
| ranosidenib | WHO MedNet |
| Synonym | Source |
|---|---|
| Hmpl-306 | ChEMBL |