EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:7596 - nitroprusside
| Formula | C5FeN6O |
| Net Charge | -2 |
| Average Mass | 215.941 |
| Monoisotopic Mass | 215.94939 |
| SMILES | N#[C][Fe-2]([C]#N)([C]#N)([C]#N)([C]#N)[N]=O |
| InChI | InChI=1S/5CN.Fe.NO/c5*1-2;;1-2/q;;;;;2*-1 |
| InChIKey | ASPOIVQEUUCDQT-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Applications: | antidepressant Antidepressants are mood-stimulating drugs used primarily in the treatment of affective disorders and related conditions. antihypertensive agent Any drug used in the treatment of acute or chronic vascular hypertension regardless of pharmacological mechanism. cardiovascular drug A drug that affects the rate or intensity of cardiac contraction, blood vessel diameter or blood volume. vasoconstrictor agent Drug used to cause constriction of the blood vessels. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| nitroprusside (CHEBI:7596) has role antidepressant (CHEBI:35469) |
| nitroprusside (CHEBI:7596) has role antihypertensive agent (CHEBI:35674) |
| nitroprusside (CHEBI:7596) has role cardiovascular drug (CHEBI:35554) |
| nitroprusside (CHEBI:7596) has role vasoconstrictor agent (CHEBI:50514) |
| nitroprusside (CHEBI:7596) is a iron coordination entity (CHEBI:33892) |
| Incoming Relation(s) |
| sodium nitroprusside (CHEBI:29321) has part nitroprusside (CHEBI:7596) |
| IUPAC Names |
|---|
| pentacyanidonitrosylferrate(2−) |
| pentacyanidonitrosylferrate(III) |
| Synonyms | Source |
|---|---|
| [Fe(CN)5(NO)]2− | IUPAC |
| Nitroferricyanide | ChemIDplus |
| Nitroprusside | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| CAS:15078-28-1 | ChemIDplus |
| CAS:15078-28-1 | KEGG COMPOUND |
| Citations |
|---|