EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
We are looking for a new Chemistry curator to join the ChEBI team. Find out more about it here.
CHEBI:29321 - sodium nitroprusside
| Formula | C5FeN6O.2Na |
| Net Charge | 0 |
| Average Mass | 261.921 |
| Monoisotopic Mass | 261.92783 |
| SMILES | N#[C][Fe-2]([C]#N)([C]#N)([C]#N)([C]#N)[N]=O.[Na+].[Na+] |
| InChI | InChI=1S/5CN.Fe.NO.2Na/c5*1-2;;1-2;;/q;;;;;2*-1;2*+1 |
| InChIKey | FPWUWQVZUNFZQM-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | nitric oxide donor An agent, with unique chemical structure and biochemical requirements, which generates nitric oxide. |
| Applications: | cardiovascular drug A drug that affects the rate or intensity of cardiac contraction, blood vessel diameter or blood volume. antipsychotic agent Antipsychotic drugs are agents that control agitated psychotic behaviour, alleviate acute psychotic states, reduce psychotic symptoms, and exert a quieting effect. geroprotector Any compound that supports healthy aging, slows the biological aging process, or extends lifespan. vasodilator agent A drug used to cause dilation of the blood vessels. anti-inflammatory agent Any compound that has anti-inflammatory effects. antidepressant Antidepressants are mood-stimulating drugs used primarily in the treatment of affective disorders and related conditions. antihypertensive agent Any drug used in the treatment of acute or chronic vascular hypertension regardless of pharmacological mechanism. anti-anaemic agent A compound which increases either the number of red cells or the amount of haemoglobin in the blood. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| sodium nitroprusside (CHEBI:29321) has part nitroprusside (CHEBI:7596) |
| sodium nitroprusside (CHEBI:29321) has role anti-anaemic agent (CHEBI:75835) |
| sodium nitroprusside (CHEBI:29321) has role anti-inflammatory agent (CHEBI:67079) |
| sodium nitroprusside (CHEBI:29321) has role antidepressant (CHEBI:35469) |
| sodium nitroprusside (CHEBI:29321) has role antihypertensive agent (CHEBI:35674) |
| sodium nitroprusside (CHEBI:29321) has role antipsychotic agent (CHEBI:35476) |
| sodium nitroprusside (CHEBI:29321) has role cardiovascular drug (CHEBI:35554) |
| sodium nitroprusside (CHEBI:29321) has role geroprotector (CHEBI:176497) |
| sodium nitroprusside (CHEBI:29321) has role nitric oxide donor (CHEBI:50566) |
| sodium nitroprusside (CHEBI:29321) has role vasodilator agent (CHEBI:35620) |
| sodium nitroprusside (CHEBI:29321) is a organic sodium salt (CHEBI:38700) |
| Incoming Relation(s) |
| sodium nitroprusside dihydrate (CHEBI:9179) has part sodium nitroprusside (CHEBI:29321) |
| IUPAC Names |
|---|
| sodium pentacyanidonitrosylferrate(2−) |
| sodium pentacyanidonitrosylferrate(III) |
| Synonyms | Source |
|---|---|
| disodium pentacyanidonitrosylferrate | IUPAC |
| Na2[Fe(CN)5(NO)] | IUPAC |
| Nipruss | ChEMBL |
| Nitroprusside sodium | ChEMBL |
| NSC-755844 | ChEMBL |
| Sodium nitroprusside | ChEMBL |
| Brand Name | Source |
|---|---|
| Nipride | ChEMBL |
| Registry Numbers | Sources |
|---|---|
| CAS:14402-89-2 | ChemIDplus |
| Citations |
|---|