EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H17NO7 |
| Net Charge | 0 |
| Average Mass | 263.246 |
| Monoisotopic Mass | 263.10050 |
| SMILES | O=C(O)[C@@H]1C[C@H](O[C@H]2O[C@@H](CO)[C@H](O)[C@H]2O)CN1 |
| InChI | InChI=1S/C10H17NO7/c12-3-6-7(13)8(14)10(18-6)17-4-1-5(9(15)16)11-2-4/h4-8,10-14H,1-3H2,(H,15,16)/t4-,5-,6-,7-,8+,10-/m0/s1 |
| InChIKey | ABCIYWCIWZHVKW-BFZMHJHUSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-O-(β-L-Araf)-cis-L-Hyp (CHEBI:75933) has functional parent cis-4-hydroxy-L-proline (CHEBI:28397) |
| 4-O-(β-L-Araf)-cis-L-Hyp (CHEBI:75933) is a O4-glycosyl-L-hydroxyproline (CHEBI:21993) |
| 4-O-(β-L-Araf)-cis-L-Hyp (CHEBI:75933) is a L-proline derivative (CHEBI:84186) |
| 4-O-(β-L-Araf)-cis-L-Hyp (CHEBI:75933) is a monosaccharide derivative (CHEBI:63367) |
| 4-O-(β-L-Araf)-cis-L-Hyp (CHEBI:75933) is a non-proteinogenic L-α-amino acid (CHEBI:83822) |
| 4-O-(β-L-Araf)-cis-L-Hyp (CHEBI:75933) is tautomer of 4-O-(β-L-Araf)-cis-L-Hyp zwitterion (CHEBI:75880) |
| Incoming Relation(s) |
| 4-O-(β-L-Araf)-cis-L-Hyp zwitterion (CHEBI:75880) is tautomer of 4-O-(β-L-Araf)-cis-L-Hyp (CHEBI:75933) |
| IUPAC Name |
|---|
| (4S)-4-(β-L-arabinofuranosyloxy)-L-proline |
| Citations |
|---|