EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:28397 - cis-4-hydroxy-L-proline
| Formula | C5H9NO3 |
| Net Charge | 0 |
| Average Mass | 131.131 |
| Monoisotopic Mass | 131.05824 |
| SMILES | O=C(O)[C@@H]1C[C@H](O)CN1 |
| InChI | InChI=1S/C5H9NO3/c7-3-1-4(5(8)9)6-2-3/h3-4,6-7H,1-2H2,(H,8,9)/t3-,4-/m0/s1 |
| InChIKey | PMMYEEVYMWASQN-IMJSIDKUSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cis-4-hydroxy-L-proline (CHEBI:28397) has role metabolite (CHEBI:25212) |
| cis-4-hydroxy-L-proline (CHEBI:28397) is a 4-hydroxyproline (CHEBI:20392) |
| cis-4-hydroxy-L-proline (CHEBI:28397) is a non-proteinogenic L-α-amino acid (CHEBI:83822) |
| cis-4-hydroxy-L-proline (CHEBI:28397) is tautomer of cis-4-hydroxy-L-proline zwitterion (CHEBI:63727) |
| Incoming Relation(s) |
| 4-O-(β-L-Araf-(1→2)-β-L-Araf-(1→2)-β-L-Araf)-cis-L-Hyp (CHEBI:75894) has functional parent cis-4-hydroxy-L-proline (CHEBI:28397) |
| 4-O-(β-L-Araf)-cis-L-Hyp (CHEBI:75933) has functional parent cis-4-hydroxy-L-proline (CHEBI:28397) |
| cis-4-hydroxy-L-proline zwitterion (CHEBI:63727) is tautomer of cis-4-hydroxy-L-proline (CHEBI:28397) |
| IUPAC Name |
|---|
| (4S)-4-hydroxy-L-proline |
| Synonyms | Source |
|---|---|
| (2S,4S)-4-hydroxy-2-pyrrolidinecarboxylic acid | ChEBI |
| 4-cis-L-hydroxyproline | ChEBI |
| cis-4-Hydroxy-L-proline | KEGG COMPOUND |
| allo-4-hydroxy-L-proline | ChemIDplus |
| L-allo-hydroxyproline | ChemIDplus |
| L-cis-4-hydroxyproline | ChEBI |
| Citations |
|---|