EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H14N2O2 |
| Net Charge | 0 |
| Average Mass | 254.289 |
| Monoisotopic Mass | 254.10553 |
| SMILES | NC(=O)Cc1cccc(C(=O)c2ccccc2)c1N |
| InChI | InChI=1S/C15H14N2O2/c16-13(18)9-11-7-4-8-12(14(11)17)15(19)10-5-2-1-3-6-10/h1-8H,9,17H2,(H2,16,18) |
| InChIKey | QEFAQIPZVLVERP-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | cyclooxygenase 1 inhibitor A cyclooxygenase inhibitor that interferes with the action of cyclooxygenase 1. non-narcotic analgesic A drug that has principally analgesic, antipyretic and anti-inflammatory actions. Non-narcotic analgesics do not bind to opioid receptors. cyclooxygenase 2 inhibitor A cyclooxygenase inhibitor that interferes with the action of cyclooxygenase 2. |
| Applications: | non-steroidal anti-inflammatory drug An anti-inflammatory drug that is not a steroid. In addition to anti-inflammatory actions, non-steroidal anti-inflammatory drugs have analgesic, antipyretic, and platelet-inhibitory actions. They act by blocking the synthesis of prostaglandins by inhibiting cyclooxygenase, which converts arachidonic acid to cyclic endoperoxides, precursors of prostaglandins. prodrug A compound that, on administration, must undergo chemical conversion by metabolic processes before becoming the pharmacologically active drug for which it is a prodrug. non-narcotic analgesic A drug that has principally analgesic, antipyretic and anti-inflammatory actions. Non-narcotic analgesics do not bind to opioid receptors. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| nepafenac (CHEBI:75922) has role cyclooxygenase 1 inhibitor (CHEBI:50630) |
| nepafenac (CHEBI:75922) has role cyclooxygenase 2 inhibitor (CHEBI:50629) |
| nepafenac (CHEBI:75922) has role non-narcotic analgesic (CHEBI:35481) |
| nepafenac (CHEBI:75922) has role non-steroidal anti-inflammatory drug (CHEBI:35475) |
| nepafenac (CHEBI:75922) has role prodrug (CHEBI:50266) |
| nepafenac (CHEBI:75922) is a monocarboxylic acid amide (CHEBI:29347) |
| IUPAC Name |
|---|
| 2-(2-amino-3-benzoylphenyl)acetamide |
| INNs | Source |
|---|---|
| nepafenac | ChemIDplus |
| népafénac | WHO MedNet |
| nepafenaco | WHO MedNet |
| nepafenacum | WHO MedNet |
| Synonyms | Source |
|---|---|
| 2-amino-3-benzoylbenzeneacetamide | ChemIDplus |
| AHR 9434 | ChemIDplus |
| AHR-9434 | ChemIDplus |
| AL 6515 | ChemIDplus |
| AL-6515 | ChemIDplus |
| Brand Name | Source |
|---|---|
| Nevanac | KEGG DRUG |
| Manual Xrefs | Databases |
|---|---|
| 1899 | DrugCentral |
| D05143 | KEGG DRUG |
| DB06802 | DrugBank |
| HMDB0015678 | HMDB |
| Nepafenac | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4256257 | Reaxys |
| CAS:78281-72-8 | ChemIDplus |
| Citations |
|---|