EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H8O4 |
| Net Charge | 0 |
| Average Mass | 156.137 |
| Monoisotopic Mass | 156.04226 |
| SMILES | O=C(O)C1=C[C@@H](O)[C@H](O)C=C1 |
| InChI | InChI=1S/C7H8O4/c8-5-2-1-4(7(10)11)3-6(5)9/h1-3,5-6,8-9H,(H,10,11)/t5-,6-/m1/s1 |
| InChIKey | HEZMWWAKWCSUCB-PHDIDXHHSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (3R,4R)-3,4-dihydroxycyclohexa-1,5-diene-1-carboxylic acid (CHEBI:75876) is a cyclohexadienecarboxylic acid (CHEBI:23468) |
| (3R,4R)-3,4-dihydroxycyclohexa-1,5-diene-1-carboxylic acid (CHEBI:75876) is a cyclohexadienediol (CHEBI:23469) |
| (3R,4R)-3,4-dihydroxycyclohexa-1,5-diene-1-carboxylic acid (CHEBI:75876) is a α,β-unsaturated monocarboxylic acid (CHEBI:79020) |
| (3R,4R)-3,4-dihydroxycyclohexa-1,5-diene-1-carboxylic acid (CHEBI:75876) is conjugate acid of (3R,4R)-3,4-dihydroxycyclohexa-1,5-diene-1-carboxylate (CHEBI:75717) |
| Incoming Relation(s) |
| (3R,4R)-3,4-dihydroxycyclohexa-1,5-diene-1-carboxylate (CHEBI:75717) is conjugate base of (3R,4R)-3,4-dihydroxycyclohexa-1,5-diene-1-carboxylic acid (CHEBI:75876) |
| IUPAC Name |
|---|
| (3R,4R)-3,4-dihydroxycyclohexa-1,5-diene-1-carboxylic acid |
| Synonyms | Source |
|---|---|
| (3R,4R)-3,4-dihydroxy-3,4-dihydrobenzoic acid | ChEBI |
| DCDC | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2936284 | Reaxys |
| Citations |
|---|