EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:75851 - (2S,3R)-capreomycidine
| Formula | C6H12N4O2 |
| Net Charge | 0 |
| Average Mass | 172.188 |
| Monoisotopic Mass | 172.09603 |
| SMILES | [H][C@]1([C@H](N)C(=O)O)CCNC(=N)N1 |
| InChI | InChI=1S/C6H12N4O2/c7-4(5(11)12)3-1-2-9-6(8)10-3/h3-4H,1-2,7H2,(H,11,12)(H3,8,9,10)/t3-,4+/m1/s1 |
| InChIKey | XHNWDEHKMJLKGG-DMTCNVIQSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (2S,3R)-capreomycidine (CHEBI:75851) has role metabolite (CHEBI:25212) |
| (2S,3R)-capreomycidine (CHEBI:75851) is a L-arginine derivative (CHEBI:83965) |
| (2S,3R)-capreomycidine (CHEBI:75851) is a guanidines (CHEBI:24436) |
| (2S,3R)-capreomycidine (CHEBI:75851) is a non-proteinogenic L-α-amino acid (CHEBI:83822) |
| (2S,3R)-capreomycidine (CHEBI:75851) is a pyrimidines (CHEBI:39447) |
| (2S,3R)-capreomycidine (CHEBI:75851) is conjugate base of (2S,3R)-capreomycidine(1+) (CHEBI:75665) |
| Incoming Relation(s) |
| (2S,3R)-capreomycidine(1+) (CHEBI:75665) is conjugate acid of (2S,3R)-capreomycidine (CHEBI:75851) |
| Synonyms | Source |
|---|---|
| L-Capreomycidine | KEGG COMPOUND |
| (2S,3R)-Capreomycidine | KEGG COMPOUND |
| Citations |
|---|