EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H13N4O2 |
| Net Charge | +1 |
| Average Mass | 173.196 |
| Monoisotopic Mass | 173.10330 |
| SMILES | [H][C@]1([C@H]([NH3+])C(=O)[O-])CCNC(=[NH2+])N1 |
| InChI | InChI=1S/C6H12N4O2/c7-4(5(11)12)3-1-2-9-6(8)10-3/h3-4H,1-2,7H2,(H,11,12)(H3,8,9,10)/p+1/t3-,4+/m1/s1 |
| InChIKey | XHNWDEHKMJLKGG-DMTCNVIQSA-O |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (2S,3R)-capreomycidine(1+) (CHEBI:75665) is a α-amino-acid cation (CHEBI:33719) |
| (2S,3R)-capreomycidine(1+) (CHEBI:75665) is conjugate acid of (2S,3R)-capreomycidine (CHEBI:75851) |
| Incoming Relation(s) |
| (2S,3R)-capreomycidine (CHEBI:75851) is conjugate base of (2S,3R)-capreomycidine(1+) (CHEBI:75665) |
| IUPAC Name |
|---|
| (2S)-azaniumyl[(4R)-2-iminiohexahydropyrimidin-4-yl]acetate |
| UniProt Name | Source |
|---|---|
| (2S,3R)-capreomycidine | UniProt |
| Manual Xrefs | Databases |
|---|---|
| CPD-15414 | MetaCyc |
| Citations |
|---|