EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H42O7P2 |
| Net Charge | 0 |
| Average Mass | 456.497 |
| Monoisotopic Mass | 456.24058 |
| SMILES | C/C(=C\COP(=O)(O)OP(=O)(O)O)CCC[C@H](C)CCC[C@H](C)CCCC(C)C |
| InChI | InChI=1S/C20H42O7P2/c1-17(2)9-6-10-18(3)11-7-12-19(4)13-8-14-20(5)15-16-26-29(24,25)27-28(21,22)23/h15,17-19H,6-14,16H2,1-5H3,(H,24,25)(H2,21,22,23)/b20-15+/t18-,19-/m1/s1 |
| InChIKey | ITPLBNCCPZSWEU-PYDDKJGSSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| phytyl diphosphate (CHEBI:75837) has functional parent phytol (CHEBI:17327) |
| phytyl diphosphate (CHEBI:75837) is a (E)-3,7,11,15-tetramethylhexadec-2-en-1-yl diphosphate (CHEBI:18187) |
| phytyl diphosphate (CHEBI:75837) is conjugate acid of phytyl diphosphate(3−) (CHEBI:75434) |
| Incoming Relation(s) |
| phytyl diphosphate(3−) (CHEBI:75434) is conjugate base of phytyl diphosphate (CHEBI:75837) |
| IUPAC Name |
|---|
| (2E,7R,11R)-3,7,11,15-tetramethylhexadec-2-en-1-yl trihydrogen diphosphate |
| Synonym | Source |
|---|---|
| 3,7R,11R,15-tetramethyl-2E-hexadecen-1-ol diphosphate | LIPID MAPS |
| Manual Xrefs | Databases |
|---|---|
| C05427 | KEGG COMPOUND |
| LMPR0104010008 | LIPID MAPS |
| C00007255 | KNApSAcK |