EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H39O7P2 |
| Net Charge | -3 |
| Average Mass | 453.473 |
| Monoisotopic Mass | 453.21875 |
| SMILES | C/C(=C\COP(=O)([O-])OP(=O)([O-])[O-])CCC[C@H](C)CCC[C@H](C)CCCC(C)C |
| InChI | InChI=1S/C20H42O7P2/c1-17(2)9-6-10-18(3)11-7-12-19(4)13-8-14-20(5)15-16-26-29(24,25)27-28(21,22)23/h15,17-19H,6-14,16H2,1-5H3,(H,24,25)(H2,21,22,23)/p-3/b20-15+/t18-,19-/m1/s1 |
| InChIKey | ITPLBNCCPZSWEU-PYDDKJGSSA-K |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| phytyl diphosphate(3−) (CHEBI:75434) is a (E)-3,7,11,15-tetramethylhexadec-2-en-1-yl diphosphate(3−) (CHEBI:58404) |
| phytyl diphosphate(3−) (CHEBI:75434) is conjugate base of phytyl diphosphate (CHEBI:75837) |
| Incoming Relation(s) |
| phytyl diphosphate (CHEBI:75837) is conjugate acid of phytyl diphosphate(3−) (CHEBI:75434) |
| Synonym | Source |
|---|---|
| (R)-phytyl diphosphate(3−) | ChEBI |
| UniProt Name | Source |
|---|---|
| phytyl diphosphate | UniProt |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4275763 | Reaxys |