EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C39H72O5 |
| Net Charge | 0 |
| Average Mass | 621.000 |
| Monoisotopic Mass | 620.53798 |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)OC[C@@H](CO)OC(=O)CCCCCCC/C=C\CCCCCCCC |
| InChI | InChI=1S/C39H72O5/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-38(41)43-36-37(35-40)44-39(42)34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-4-2/h17-20,37,40H,3-16,21-36H2,1-2H3/b19-17-,20-18-/t37-/m1/s1 |
| InChIKey | AFSHUZFNMVJNKX-DSSVUWSHSA-N |
| Roles Classification |
|---|
| Biological Roles: | Saccharomyces cerevisiae metabolite Any fungal metabolite produced during a metabolic reaction in Baker's yeast (Saccharomyces cerevisiae ). human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2,3-dioleoyl-sn-glycerol (CHEBI:75824) has functional parent oleic acid (CHEBI:16196) |
| 2,3-dioleoyl-sn-glycerol (CHEBI:75824) is a 2,3-diacyl-sn-glycerol (CHEBI:75524) |
| 2,3-dioleoyl-sn-glycerol (CHEBI:75824) is a dioleoylglycerol (CHEBI:75945) |
| 2,3-dioleoyl-sn-glycerol (CHEBI:75824) is enantiomer of 1,2-dioleoyl-sn-glycerol (CHEBI:52333) |
| Incoming Relation(s) |
| 1,2-dioleoyl-sn-glycerol (CHEBI:52333) is enantiomer of 2,3-dioleoyl-sn-glycerol (CHEBI:75824) |
| IUPAC Name |
|---|
| (2R)-3-hydroxypropane-1,2-diyl (9Z,9'Z)bis-octadec-9-enoate |
| Synonyms | Source |
|---|---|
| DG(0:0/18:1(ω-9)/18:1(ω-9)) | SUBMITTER |
| (R)-diolein | ChEBI |
| UniProt Name | Source |
|---|---|
| 2,3-di-(9Z)-octadecenoyl-sn-glycerol | UniProt |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1730456 | Reaxys |