EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C39H72O5 |
| Net Charge | 0 |
| Average Mass | 621.000 |
| Monoisotopic Mass | 620.53798 |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)OC[C@H](CO)OC(=O)CCCCCCC/C=C\CCCCCCCC |
| InChI | InChI=1S/C39H72O5/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-38(41)43-36-37(35-40)44-39(42)34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-4-2/h17-20,37,40H,3-16,21-36H2,1-2H3/b19-17-,20-18-/t37-/m0/s1 |
| InChIKey | AFSHUZFNMVJNKX-LLWMBOQKSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mus musculus (ncbitaxon:10090) | - | MetaboLights (MTBLS143) |
| Roles Classification |
|---|
| Biological Roles: | mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). Saccharomyces cerevisiae metabolite Any fungal metabolite produced during a metabolic reaction in Baker's yeast (Saccharomyces cerevisiae ). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1,2-dioleoyl-sn-glycerol (CHEBI:52333) has role mouse metabolite (CHEBI:75771) |
| 1,2-dioleoyl-sn-glycerol (CHEBI:52333) is a 1,2-diacyl-sn-glycerol (CHEBI:17815) |
| 1,2-dioleoyl-sn-glycerol (CHEBI:52333) is a 1,2-dioleoylglycerol (CHEBI:52323) |
| 1,2-dioleoyl-sn-glycerol (CHEBI:52333) is enantiomer of 2,3-dioleoyl-sn-glycerol (CHEBI:75824) |
| Incoming Relation(s) |
| 2,3-dioleoyl-sn-glycerol (CHEBI:75824) is enantiomer of 1,2-dioleoyl-sn-glycerol (CHEBI:52333) |
| IUPAC Name |
|---|
| (2S)-3-hydroxypropane-1,2-diyl (9Z)bis-octadec-9-enoate |
| Synonyms | Source |
|---|---|
| DG(18:1/18:1/0:0) | LIPID MAPS |
| DG(18:1(9Z)/18:1(9Z)/0:0) | LIPID MAPS |
| sn-1,2-Diolein | ChemIDplus |
| sn-1,2-dioleoylglycerol | ChemIDplus |
| UniProt Name | Source |
|---|---|
| 1,2-di-(9Z-octadecenoyl)-sn-glycerol | UniProt |
| Manual Xrefs | Databases |
|---|---|
| HMDB0007218 | HMDB |
| LMGL02010049 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1730457 | Reaxys |
| CAS:24529-88-2 | ChemIDplus |