EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H10F3N3O4 |
| Net Charge | 0 |
| Average Mass | 317.223 |
| Monoisotopic Mass | 317.06234 |
| SMILES | CC1(C)NC(=O)N(c2ccc([N+](=O)[O-])c(C(F)(F)F)c2)C1=O |
| InChI | InChI=1S/C12H10F3N3O4/c1-11(2)9(19)17(10(20)16-11)6-3-4-8(18(21)22)7(5-6)12(13,14)15/h3-5H,1-2H3,(H,16,20) |
| InChIKey | XWXYUMMDTVBTOU-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | androgen antagonist A compound which inhibits or antagonises the biosynthesis or actions of androgens. |
| Applications: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. androgen antagonist A compound which inhibits or antagonises the biosynthesis or actions of androgens. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| nilutamide (CHEBI:7573) has role androgen antagonist (CHEBI:35497) |
| nilutamide (CHEBI:7573) has role antineoplastic agent (CHEBI:35610) |
| nilutamide (CHEBI:7573) is a (trifluoromethyl)benzenes (CHEBI:83565) |
| nilutamide (CHEBI:7573) is a C-nitro compound (CHEBI:35716) |
| nilutamide (CHEBI:7573) is a imidazolidinone (CHEBI:55370) |
| IUPAC Name |
|---|
| 5,5-dimethyl-3-[4-nitro-3-(trifluoromethyl)phenyl]imidazolidine-2,4-dione |
| INNs | Source |
|---|---|
| nilutamida | ChemIDplus |
| nilutamide | KEGG DRUG |
| nilutamidum | ChemIDplus |
| Synonyms | Source |
|---|---|
| 5,5-Dimethyl-3-(α,α,α-trifluoro-4-nitro-m-tolyl)hydantoin | ChemIDplus |
| Nilutamide | KEGG COMPOUND |
| Brand Name | Source |
|---|---|
| Nilandron | DrugBank |
| Registry Numbers | Sources |
|---|---|
| Beilstein:841906 | Beilstein |
| CAS:63612-50-0 | KEGG COMPOUND |
| CAS:63612-50-0 | ChemIDplus |