EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H11ClO3 |
| Net Charge | 0 |
| Average Mass | 214.648 |
| Monoisotopic Mass | 214.03967 |
| SMILES | Cc1cc(Cl)ccc1O[C@@H](C)C(=O)O |
| InChI | InChI=1S/C10H11ClO3/c1-6-5-8(11)3-4-9(6)14-7(2)10(12)13/h3-5,7H,1-2H3,(H,12,13)/t7-/m0/s1 |
| InChIKey | WNTGYJSOUMFZEP-ZETCQYMHSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (S)-mecoprop (CHEBI:75712) is a 2-(4-chloro-2-methylphenoxy)propanoic acid (CHEBI:75704) |
| (S)-mecoprop (CHEBI:75712) is conjugate acid of (S)-2-(4-chloro-2-methylphenoxy)propanoate (CHEBI:75285) |
| (S)-mecoprop (CHEBI:75712) is enantiomer of (R)-mecoprop (CHEBI:75703) |
| Incoming Relation(s) |
| mecoprop (CHEBI:75711) has part (S)-mecoprop (CHEBI:75712) |
| (S)-2-(4-chloro-2-methylphenoxy)propanoate (CHEBI:75285) is conjugate base of (S)-mecoprop (CHEBI:75712) |
| (R)-mecoprop (CHEBI:75703) is enantiomer of (S)-mecoprop (CHEBI:75712) |
| Synonym | Source |
|---|---|
| (S)-MCPP | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:3201761 | Reaxys |