EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H11ClO3 |
| Net Charge | 0 |
| Average Mass | 214.648 |
| Monoisotopic Mass | 214.03967 |
| SMILES | Cc1cc(Cl)ccc1O[C@H](C)C(=O)O |
| InChI | InChI=1S/C10H11ClO3/c1-6-5-8(11)3-4-9(6)14-7(2)10(12)13/h3-5,7H,1-2H3,(H,12,13)/t7-/m1/s1 |
| InChIKey | WNTGYJSOUMFZEP-SSDOTTSWSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Application: | phenoxy herbicide Any member of the class of herbicides whose members contain a phenoxy or substituted phenoxy group. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (R)-mecoprop (CHEBI:75703) has role phenoxy herbicide (CHEBI:60575) |
| (R)-mecoprop (CHEBI:75703) is a 2-(4-chloro-2-methylphenoxy)propanoic acid (CHEBI:75704) |
| (R)-mecoprop (CHEBI:75703) is conjugate acid of (R)-2-(4-chloro-2-methylphenoxy)propanoate (CHEBI:75284) |
| (R)-mecoprop (CHEBI:75703) is enantiomer of (S)-mecoprop (CHEBI:75712) |
| Incoming Relation(s) |
| mecoprop (CHEBI:75711) has part (R)-mecoprop (CHEBI:75703) |
| (R)-2-(4-chloro-2-methylphenoxy)propanoate (CHEBI:75284) is conjugate base of (R)-mecoprop (CHEBI:75703) |
| (S)-mecoprop (CHEBI:75712) is enantiomer of (R)-mecoprop (CHEBI:75703) |
| IUPAC Name |
|---|
| (2R)-2-(4-chloro-2-methylphenoxy)propanoic acid |
| Synonyms | Source |
|---|---|
| (2R)-2-(4-chloro-2-methylphenoxy)propionic acid | ChEBI |
| 2M-4XP | ChemIDplus |
| d-Mecoprop | ChemIDplus |
| (R)-2-(4-chloro-2-methylphenoxy)propanoic acid | ChEBI |
| (R)-MCPP | ChEBI |
| (+)-Mcpp | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 431 | PPDB |
| C18608 | KEGG COMPOUND |
| CA2703613 | Patent |
| Mecoprop | Wikipedia |
| mecoprop-p | Alan Wood's Pesticides |
| WO2009053063 | Patent |
| WO2010017929 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1960621 | Reaxys |
| CAS:16484-77-8 | ChemIDplus |
| CAS:16484-77-8 | KEGG COMPOUND |
| Citations |
|---|