EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H21Cl2NO |
| Net Charge | 0 |
| Average Mass | 314.256 |
| Monoisotopic Mass | 313.10002 |
| SMILES | COC[C@@H]1[C@@H](c2ccc(Cl)c(Cl)c2)C[C@@H]2CC[C@H]1N2C |
| InChI | InChI=1S/C16H21Cl2NO/c1-19-11-4-6-16(19)13(9-20-2)12(8-11)10-3-5-14(17)15(18)7-10/h3,5,7,11-13,16H,4,6,8-9H2,1-2H3/t11-,12+,13+,16+/m0/s1 |
| InChIKey | PGYDXVBZYKQYCS-VPWBDBDCSA-N |
| Roles Classification |
|---|
| Application: | antidepressant Antidepressants are mood-stimulating drugs used primarily in the treatment of affective disorders and related conditions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ns-2359 (CHEBI:756876) has parent hydride tropane (CHEBI:35615) |
| ns-2359 (CHEBI:756876) has role antidepressant (CHEBI:35469) |
| ns-2359 (CHEBI:756876) is a azabicycloalkane (CHEBI:38295) |
| Synonyms | Source |
|---|---|
| GSK-372,475 | ChEMBL |
| GSK-372475 | ChEMBL |
| GSK372475 | ChEMBL |
| Ns-2359 | ChEMBL |
| NS2359 | ChEMBL |