EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H15N |
| Net Charge | 0 |
| Average Mass | 125.215 |
| Monoisotopic Mass | 125.12045 |
| SMILES | CN1[C@@H]2CCC[C@H]1CC2 |
| InChI | InChI=1S/C8H15N/c1-9-7-3-2-4-8(9)6-5-7/h7-8H,2-6H2,1H3/t7-,8+ |
| InChIKey | XLRPYZSEQKXZAA-OCAPTIKFSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tropane (CHEBI:35615) is a alkaloid fundamental parent (CHEBI:35506) |
| tropane (CHEBI:35615) is a azabicycloalkane (CHEBI:38295) |
| tropane (CHEBI:35615) is a saturated organic heterobicyclic parent (CHEBI:38419) |
| tropane (CHEBI:35615) is a tropane alkaloid (CHEBI:37332) |
| Incoming Relation(s) |
| (1R,3S)-3-(4-iodophenyl)-8-methyl-8-azabicyclo[3.2.1]octane-4-carboxylic acid methyl ester (CHEBI:125381) has parent hydride tropane (CHEBI:35615) |
| 3-(4-methoxyphenyl)-8-(6-methyl-2-phenyl-4-pyrimidinyl)-8-azabicyclo[3.2.1]octan-3-ol (CHEBI:116457) has parent hydride tropane (CHEBI:35615) |
| 8-[(1-cyclohexyl-5-tetrazolyl)methyl]-3-(4-fluorophenyl)-8-azabicyclo[3.2.1]octan-3-ol (CHEBI:120800) has parent hydride tropane (CHEBI:35615) |
| altropane (CHEBI:135696) has parent hydride tropane (CHEBI:35615) |
| IUPAC Name |
|---|
| tropane |
| Synonyms | Source |
|---|---|
| (1R,5S)-8-methyl-8-azabicyclo[3.2.1]octane | IUPAC |
| 1αH,5αH-tropane | NIST Chemistry WebBook |
| 2,3-dihydro-8-methylnortropidine | NIST Chemistry WebBook |
| N-methyl-8-azabicyclo[3.2.1]octane | NIST Chemistry WebBook |