EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:756251 - tesofensine
| Formula | C17H23Cl2NO |
| Net Charge | 0 |
| Average Mass | 328.283 |
| Monoisotopic Mass | 327.11567 |
| SMILES | [H][C@@]12CC[C@@]([H])(N1C)[C@]([H])(COCC)[C@@H](c1ccc(Cl)c(Cl)c1)C2 |
| InChI | InChI=1S/C17H23Cl2NO/c1-3-21-10-14-13(9-12-5-7-17(14)20(12)2)11-4-6-15(18)16(19)8-11/h4,6,8,12-14,17H,3,5,7,9-10H2,1-2H3/t12-,13+,14+,17+/m0/s1 |
| InChIKey | VCVWXKKWDOJNIT-ZOMKSWQUSA-N |
| Roles Classification |
|---|
| Biological Role: | anti-obesity agent Any substance which is used to reduce or control weight. |
| Applications: | antiparkinson drug A drug used in the treatment of Parkinson's disease. hypoglycemic agent A drug which lowers the blood glucose level. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tesofensine (CHEBI:756251) has parent hydride tropane (CHEBI:35615) |
| tesofensine (CHEBI:756251) has role anti-obesity agent (CHEBI:74518) |
| tesofensine (CHEBI:756251) has role antiparkinson drug (CHEBI:48407) |
| tesofensine (CHEBI:756251) has role hypoglycemic agent (CHEBI:35526) |
| tesofensine (CHEBI:756251) is a azabicycloalkane (CHEBI:38295) |
| INNs | Source |
|---|---|
| tesofensina | WHO MedNet |
| tesofensine | WHO MedNet |
| Synonyms | Source |
|---|---|
| Ns2330 | ChEMBL |
| NS 2330 | ChEMBL |
| NS-2330 | ChEMBL |