EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H38O4 |
| Net Charge | 0 |
| Average Mass | 354.531 |
| Monoisotopic Mass | 354.27701 |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCC(=O)OCC(O)CO |
| InChI | InChI=1S/C21H38O4/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-21(24)25-19-20(23)18-22/h6-7,9-10,20,22-23H,2-5,8,11-19H2,1H3/b7-6-,10-9- |
| InChIKey | WECGLUPZRHILCT-HZJYTTRNSA-N |
| Roles Classification |
|---|
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. antiviral agent A substance that destroys or inhibits replication of viruses. human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1-monolinolein (CHEBI:75568) has functional parent linoleic acid (CHEBI:17351) |
| 1-monolinolein (CHEBI:75568) has role antiviral agent (CHEBI:22587) |
| 1-monolinolein (CHEBI:75568) has role plant metabolite (CHEBI:76924) |
| 1-monolinolein (CHEBI:75568) is a 1-acylglycerol 18:2 (CHEBI:134131) |
| Incoming Relation(s) |
| 1-linoleoyl-sn-glycerol (CHEBI:75561) is a 1-monolinolein (CHEBI:75568) |
| 3-linoleoyl-sn-glycerol (CHEBI:75563) is a 1-monolinolein (CHEBI:75568) |
| IUPAC Name |
|---|
| 2,3-dihydroxypropyl (9Z,12Z)-octadeca-9,12-dienoate |
| Synonyms | Source |
|---|---|
| 1-Linoleoylglycerol | ChEBI |
| 1-Linoleylglycerol | ChemIDplus |
| 1-monolinolein | ChEBI |
| 2,3-Dihydroxypropyl linoleate | ChemIDplus |
| alpha-Glyceryl linoleate | ChemIDplus |
| Glycerol 1-monolinolate | ChemIDplus |
| UniProt Name | Source |
|---|---|
| 1-(9Z,12Z-octadecadienoyl)-glycerol | UniProt |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1802720 | Reaxys |
| CAS:2277-28-3 | ChemIDplus |
| Citations |
|---|