EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H38O4 |
| Net Charge | 0 |
| Average Mass | 354.531 |
| Monoisotopic Mass | 354.27701 |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCC(=O)OC[C@H](O)CO |
| InChI | InChI=1S/C21H38O4/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-21(24)25-19-20(23)18-22/h6-7,9-10,20,22-23H,2-5,8,11-19H2,1H3/b7-6-,10-9-/t20-/m1/s1 |
| InChIKey | WECGLUPZRHILCT-KKFOGOCZSA-N |
| Roles Classification |
|---|
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. antiviral agent A substance that destroys or inhibits replication of viruses. human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-linoleoyl-sn-glycerol (CHEBI:75563) is a 1-monolinolein (CHEBI:75568) |
| 3-linoleoyl-sn-glycerol (CHEBI:75563) is a 3-acyl-sn-glycerol (CHEBI:64760) |
| 3-linoleoyl-sn-glycerol (CHEBI:75563) is enantiomer of 1-linoleoyl-sn-glycerol (CHEBI:75561) |
| Incoming Relation(s) |
| rac-1-monolinoleoylglycerol (CHEBI:75565) has part 3-linoleoyl-sn-glycerol (CHEBI:75563) |
| 1-linoleoyl-sn-glycerol (CHEBI:75561) is enantiomer of 3-linoleoyl-sn-glycerol (CHEBI:75563) |
| IUPAC Name |
|---|
| (2R)-2,3-dihydroxypropyl (9Z,12Z)-octadeca-9,12-dienoate |
| Synonyms | Source |
|---|---|
| 3-(9Z,12Z)-octadecadienoyl-sn-glycerol | SUBMITTER |
| sn-3-monolinoleoylglycerol | SUBMITTER |
| (R)-1-monolinolein | ChEBI |
| MG (0:0/0:0/18:2(n-6)) | SUBMITTER |
| UniProt Name | Source |
|---|---|
| 3-(9Z,12Z)-octadecadienoyl-sn-glycerol | UniProt |
| Registry Numbers | Sources |
|---|---|
| Reaxys:6589758 | Reaxys |