EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H42O4 |
| Net Charge | 0 |
| Average Mass | 358.563 |
| Monoisotopic Mass | 358.30831 |
| SMILES | CCCCCCCCCCCCCCCCCC(=O)OCC(O)CO |
| InChI | InChI=1S/C21H42O4/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-21(24)25-19-20(23)18-22/h20,22-23H,2-19H2,1H3 |
| InChIKey | VBICKXHEKHSIBG-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | Caenorhabditis elegans metabolite A nematode metabolite produced by Caenorhabditis elegans. algal metabolite Any eukaryotic metabolite produced during a metabolic reaction in algae including unicellular organisms like chlorella and diatoms to multicellular organisms like giant kelps and brown algae. human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1-monostearoylglycerol (CHEBI:75555) has role Caenorhabditis elegans metabolite (CHEBI:78804) |
| 1-monostearoylglycerol (CHEBI:75555) has role algal metabolite (CHEBI:84735) |
| 1-monostearoylglycerol (CHEBI:75555) is a 1-acylglycerol 18:0 (CHEBI:134129) |
| Incoming Relation(s) |
| 1-stearoyl-sn-glycerol (CHEBI:75550) is a 1-monostearoylglycerol (CHEBI:75555) |
| 3-stearoyl-sn-glycerol (CHEBI:75553) is a 1-monostearoylglycerol (CHEBI:75555) |
| IUPAC Name |
|---|
| 2,3-dihydroxypropyl octadecanoate |
| Synonyms | Source |
|---|---|
| 1-Stearoyl-glycerol | ChEBI |
| glycerol 1-octadecanoate | ChEBI |
| Glyceryl monostearate | ChemIDplus |
| MAG(18:0) | ChEBI |
| MAG(18:0/0:0) | ChEBI |
| MG(18:0) | ChEBI |
| UniProt Name | Source |
|---|---|
| 1-octadecanoylglycerol | UniProt |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1728685 | Reaxys |
| CAS:123-94-4 | ChemIDplus |
| Citations |
|---|