EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H42O4 |
| Net Charge | 0 |
| Average Mass | 358.563 |
| Monoisotopic Mass | 358.30831 |
| SMILES | CCCCCCCCCCCCCCCCCC(=O)OC[C@@H](O)CO |
| InChI | InChI=1S/C21H42O4/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-21(24)25-19-20(23)18-22/h20,22-23H,2-19H2,1H3/t20-/m0/s1 |
| InChIKey | VBICKXHEKHSIBG-FQEVSTJZSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Ibervillea sonorae (ncbitaxon:354617) | - | DOI (10.1055/s-2007-967117) |
| Roles Classification |
|---|
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. Caenorhabditis elegans metabolite A nematode metabolite produced by Caenorhabditis elegans. algal metabolite Any eukaryotic metabolite produced during a metabolic reaction in algae including unicellular organisms like chlorella and diatoms to multicellular organisms like giant kelps and brown algae. human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1-stearoyl-sn-glycerol (CHEBI:75550) has role plant metabolite (CHEBI:76924) |
| 1-stearoyl-sn-glycerol (CHEBI:75550) is a 1-acyl-sn-glycerol (CHEBI:64683) |
| 1-stearoyl-sn-glycerol (CHEBI:75550) is a 1-monostearoylglycerol (CHEBI:75555) |
| 1-stearoyl-sn-glycerol (CHEBI:75550) is enantiomer of 3-stearoyl-sn-glycerol (CHEBI:75553) |
| Incoming Relation(s) |
| rac-1-monostearoylglycerol (CHEBI:75557) has part 1-stearoyl-sn-glycerol (CHEBI:75550) |
| 3-stearoyl-sn-glycerol (CHEBI:75553) is enantiomer of 1-stearoyl-sn-glycerol (CHEBI:75550) |
| Synonyms | Source |
|---|---|
| sn-1-octadecanoyl-monoglyceride | SUBMITTER |
| MG (18:0/0:0/0:0) | SUBMITTER |
| (2S)-2,3-dihydroxypropyl octadecanoate | ChEBI |
| (S)-1-monostearin | ChEBI |
| (S)-(+)-1-O-stearoylglycerol | ChEBI |
| UniProt Name | Source |
|---|---|
| 1-octadecanoyl-sn-glycerol | UniProt |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5746234 | Reaxys |