EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H38O4 |
| Net Charge | 0 |
| Average Mass | 330.509 |
| Monoisotopic Mass | 330.27701 |
| SMILES | CCCCCCCCCCCCCCCC(=O)OC[C@@H](O)CO |
| InChI | InChI=1S/C19H38O4/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-19(22)23-17-18(21)16-20/h18,20-21H,2-17H2,1H3/t18-/m0/s1 |
| InChIKey | QHZLMUACJMDIAE-SFHVURJKSA-N |
| Roles Classification |
|---|
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. algal metabolite Any eukaryotic metabolite produced during a metabolic reaction in algae including unicellular organisms like chlorella and diatoms to multicellular organisms like giant kelps and brown algae. human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1-hexadecanoyl-sn-glycerol (CHEBI:75542) is a 1-acyl-sn-glycerol (CHEBI:64683) |
| 1-hexadecanoyl-sn-glycerol (CHEBI:75542) is a 1-monopalmitoylglycerol (CHEBI:69081) |
| 1-hexadecanoyl-sn-glycerol (CHEBI:75542) is a monoacylglycerol 16:0 (CHEBI:87251) |
| 1-hexadecanoyl-sn-glycerol (CHEBI:75542) is enantiomer of 3-palmitoyl-sn-glycerol (CHEBI:64757) |
| Incoming Relation(s) |
| rac-1-monopalmitoylglycerol (CHEBI:75811) has part 1-hexadecanoyl-sn-glycerol (CHEBI:75542) |
| 3-palmitoyl-sn-glycerol (CHEBI:64757) is enantiomer of 1-hexadecanoyl-sn-glycerol (CHEBI:75542) |
| IUPAC Name |
|---|
| (2S)-2,3-dihydroxypropyl hexadecanoate |
| Synonyms | Source |
|---|---|
| (2S)-1-O-hexadecanoylglycerol | ChEBI |
| (2S)-1-O-palmitoylglycerol | ChEBI |
| sn-1-palmitoylmonoglyceride | SUBMITTER |
| sn-1-palmitoylmonoglycerol | ChEBI |
| (S)-1-monopalmitin | ChEBI |
| (S)-2,3-dihydroxypropyl n-hexadecanoate | ChEBI |
| UniProt Name | Source |
|---|---|
| 1-hexadecanoyl-sn-glycerol | UniProt |
| Manual Xrefs | Databases |
|---|---|
| CPD-8508 | MetaCyc |
| HMDB0011564 | HMDB |
| LMGL01010009 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1913364 | Reaxys |
| Citations |
|---|