EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H38O4 |
| Net Charge | 0 |
| Average Mass | 330.509 |
| Monoisotopic Mass | 330.27701 |
| SMILES | CCCCCCCCCCCCCCCC(=O)OCC(O)CO |
| InChI | InChI=1S/C19H38O4/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-19(22)23-17-18(21)16-20/h18,20-21H,2-17H2,1H3 |
| InChIKey | QHZLMUACJMDIAE-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Chlamydomonas reinhardtii (ncbitaxon:3055) | - | PubMed (25515814) | |
| Neolitsea daibuensis (IPNI:466954-1) | root (BTO:0001188) | PubMed (22148193) | Cold MeOH extract of dried roots |
| Roles Classification |
|---|
| Biological Roles: | algal metabolite Any eukaryotic metabolite produced during a metabolic reaction in algae including unicellular organisms like chlorella and diatoms to multicellular organisms like giant kelps and brown algae. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1-monopalmitoylglycerol (CHEBI:69081) has functional parent hexadecanoic acid (CHEBI:15756) |
| 1-monopalmitoylglycerol (CHEBI:69081) has role algal metabolite (CHEBI:84735) |
| 1-monopalmitoylglycerol (CHEBI:69081) has role plant metabolite (CHEBI:76924) |
| 1-monopalmitoylglycerol (CHEBI:69081) is a 1-acylglycerol 16:0 (CHEBI:134127) |
| Incoming Relation(s) |
| 1-hexadecanoyl-sn-glycerol (CHEBI:75542) is a 1-monopalmitoylglycerol (CHEBI:69081) |
| 3-palmitoyl-sn-glycerol (CHEBI:64757) is a 1-monopalmitoylglycerol (CHEBI:69081) |
| IUPAC Name |
|---|
| 2,3-dihydroxypropyl palmitate |
| Synonyms | Source |
|---|---|
| 1-palmitoylglycerol | ChemIDplus |
| 2,3-dihydroxypropyl hexadecanoate | ChEBI |
| glycerol 1-monopalmitate | ChemIDplus |
| glycerol 1-palmitate | ChemIDplus |
| glycerol 3-palmitate | ChemIDplus |
| glyceryl palmitate | ChemIDplus |
| UniProt Name | Source |
|---|---|
| 1-hexadecanoylglycerol | UniProt |
| Manual Xrefs | Databases |
|---|---|
| CPD-8508 | MetaCyc |
| HMDB0031074 | HMDB |
| LSM-4482 | LINCS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1728235 | Reaxys |
| CAS:542-44-9 | ChemIDplus |
| Citations |
|---|