EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H9O7 |
| Net Charge | -1 |
| Average Mass | 193.131 |
| Monoisotopic Mass | 193.03538 |
| SMILES | O=C([O-])[C@H]1OC(O)[C@H](O)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C6H10O7/c7-1-2(8)4(5(10)11)13-6(12)3(1)9/h1-4,6-9,12H,(H,10,11)/p-1/t1-,2+,3+,4-,6?/m0/s1 |
| InChIKey | AEMOLEFTQBMNLQ-YMDCURPLSA-M |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| D-galactopyranuronate (CHEBI:75525) has role plant metabolite (CHEBI:76924) |
| D-galactopyranuronate (CHEBI:75525) is a carbohydrate acid anion (CHEBI:33721) |
| D-galactopyranuronate (CHEBI:75525) is a monocarboxylic acid anion (CHEBI:35757) |
| D-galactopyranuronate (CHEBI:75525) is conjugate base of D-galactopyranuronic acid (CHEBI:4153) |
| Incoming Relation(s) |
| β-D-galacturonate (CHEBI:85312) is a D-galactopyranuronate (CHEBI:75525) |
| D-galactopyranuronic acid (CHEBI:4153) is conjugate acid of D-galactopyranuronate (CHEBI:75525) |
| IUPAC Name |
|---|
| D-galactopyranuronate |
| UniProt Name | Source |
|---|---|
| D-galacturonate | UniProt |
| Manual Xrefs | Databases |
|---|---|
| D-Galactopyranuronate | MetaCyc |
| Registry Numbers | Sources |
|---|---|
| Reaxys:6589656 | Reaxys |