EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H10O7 |
| Net Charge | 0 |
| Average Mass | 194.139 |
| Monoisotopic Mass | 194.04265 |
| SMILES | O=C(O)[C@H]1OC(O)[C@H](O)[C@@H](O)[C@H]1O |
| WURCS | WURCS=2.0/1,1,0/[a2112A-1x_1-5]/1/ |
| InChI | InChI=1S/C6H10O7/c7-1-2(8)4(5(10)11)13-6(12)3(1)9/h1-4,6-9,12H,(H,10,11)/t1-,2+,3+,4-,6?/m0/s1 |
| InChIKey | AEMOLEFTQBMNLQ-YMDCURPLSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Roles: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | algal metabolite Any eukaryotic metabolite produced during a metabolic reaction in algae including unicellular organisms like chlorella and diatoms to multicellular organisms like giant kelps and brown algae. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| D-galactopyranuronic acid (CHEBI:4153) is a D-galacturonic acid (CHEBI:18024) |
| D-galactopyranuronic acid (CHEBI:4153) is conjugate acid of D-galactopyranuronate (CHEBI:75525) |
| Incoming Relation(s) |
| dTDP-D-galacturonic acid (CHEBI:17262) has functional parent D-galactopyranuronic acid (CHEBI:4153) |
| polygalacturonic acid (CHEBI:62969) has functional parent D-galactopyranuronic acid (CHEBI:4153) |
| α-D-galacturonic acid (CHEBI:33885) is a D-galactopyranuronic acid (CHEBI:4153) |
| β-D-galacturonic acid (CHEBI:47954) is a D-galactopyranuronic acid (CHEBI:4153) |
| D-galactopyranuronate (CHEBI:75525) is conjugate base of D-galactopyranuronic acid (CHEBI:4153) |
| IUPAC Name |
|---|
| D-galactopyranuronic acid |
| Synonym | Source |
|---|---|
| D-Galacturonic acid | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C00001120 | KNApSAcK |
| C00333 | KEGG COMPOUND |
| D-Galactopyranuronate | MetaCyc |
| D-Galacturonic_acid | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Gmelin:1421108 | Gmelin |
| Reaxys:1427739 | Reaxys |
| CAS:685-73-4 | KEGG COMPOUND |
| Citations |
|---|