EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
We are looking for a new Chemistry curator to join the ChEBI team. Find out more about it here.
CHEBI:755150 - axelopran sulfate
| Formula | H2O4S.C26H39N3O4 |
| Net Charge | 0 |
| Average Mass | 555.694 |
| Monoisotopic Mass | 555.26144 |
| SMILES | O=S(=O)(O)O.[H][C@]12CC[C@]([H])(C[C@H](c3cccc(C(N)=O)c3)C1)N2CCN(CC1CCCCC1)C(=O)[C@@H](O)CO |
| InChI | InChI=1S/C26H39N3O4.H2O4S/c27-25(32)20-8-4-7-19(13-20)21-14-22-9-10-23(15-21)29(22)12-11-28(26(33)24(31)17-30)16-18-5-2-1-3-6-18;1-5(2,3)4/h4,7-8,13,18,21-24,30-31H,1-3,5-6,9-12,14-17H2,(H2,27,32);(H2,1,2,3,4)/t21-,22+,23-,24-;/m0./s1 |
| InChIKey | QNFFAKFVKCGLPK-WTKDUOFSSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| axelopran sulfate (CHEBI:755150) has parent hydride tropane (CHEBI:35615) |
| axelopran sulfate (CHEBI:755150) is a azabicycloalkane (CHEBI:38295) |
| Synonyms | Source |
|---|---|
| Axelopran sulfate | ChEMBL |
| TD-1211 Sulfate | ChEMBL |
| Citations |
|---|