EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H39N3O4 |
| Net Charge | 0 |
| Average Mass | 457.615 |
| Monoisotopic Mass | 457.29406 |
| SMILES | [H][C@]12CC[C@]([H])(C[C@H](c3cccc(C(N)=O)c3)C1)N2CCN(CC1CCCCC1)C(=O)[C@@H](O)CO |
| InChI | InChI=1S/C26H39N3O4/c27-25(32)20-8-4-7-19(13-20)21-14-22-9-10-23(15-21)29(22)12-11-28(26(33)24(31)17-30)16-18-5-2-1-3-6-18/h4,7-8,13,18,21-24,30-31H,1-3,5-6,9-12,14-17H2,(H2,27,32)/t21-,22+,23-,24-/m0/s1 |
| InChIKey | ATLYLVPZNWDJBW-KIHHCIJBSA-N |
| Roles Classification |
|---|
| Application: | laxative An agent that produces a soft formed stool, and relaxes and loosens the bowels, typically used over a protracted period, to relieve constipation. Compare with cathartic, which is a substance that accelerates defecation. A substances can be both a laxative and a cathartic. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| axelopran (CHEBI:755145) has parent hydride tropane (CHEBI:35615) |
| axelopran (CHEBI:755145) has role laxative (CHEBI:50503) |
| axelopran (CHEBI:755145) is a azabicycloalkane (CHEBI:38295) |
| INN | Source |
|---|---|
| axelopran | WHO MedNet |
| Synonym | Source |
|---|---|
| TD-1211 | ChEMBL |